- 4,4'-Dimethoxybiphenyl
-
- $0.00 / 25kg
-
2025-12-01
- CAS:2132-80-1
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kg
- 4,4'-Dimethoxybiphenyl
-
- $1.00 / 1KG
-
2020-01-13
- CAS:2132-80-1
- Min. Order: 1KG
- Purity: 98%HPLC
- Supply Ability: 10tons
|
| | 4,4'-Dimethoxybiphenyl Basic information |
| Product Name: | 4,4'-Dimethoxybiphenyl | | Synonyms: | 4,4'-BIANISOLE;4,4'-Dimethoxy-1,1'-biphenyl;4,4'-Dimethoxybiphenyl,98%;4,4'-Dimethyoxybiphenyl;4,4′-Dimethoxybiphenyl,4,4′-Bianisole;Biphenyl, 4,4'-dimethoxy- (6CI,7CI,8CI);4,4'-DiMethoxylbiphenyl;1-methoxy-4-(4-methoxyphenyl)benzene | | CAS: | 2132-80-1 | | MF: | C14H14O2 | | MW: | 214.26 | | EINECS: | | | Product Categories: | Biphenyl & Diphenyl ether | | Mol File: | 2132-80-1.mol |  |
| | 4,4'-Dimethoxybiphenyl Chemical Properties |
| Melting point | 179-180 °C (subl.)(lit.) | | Boiling point | 314.4°C (rough estimate) | | density | 1.0781 (rough estimate) | | refractive index | 1.5570 (estimate) | | storage temp. | Store at room temperature | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C14H14O2/c1-15-13-7-3-11(4-8-13)12-5-9-14(16-2)10-6-12/h3-10H,1-2H3 | | InChIKey | UIMPAOAAAYDUKQ-UHFFFAOYSA-N | | SMILES | COc1ccc(cc1)-c2ccc(OC)cc2 | | CAS DataBase Reference | 2132-80-1(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 4,4'-Dimethoxybiphenyl Usage And Synthesis |
| Chemical Properties | light yellow shiny flakes | | Uses | 4,4′-Dimethoxybiphenyl was used to study the coupled methyl-group rotation and methoxy-group libration. | | Synthesis Reference(s) | Journal of the American Chemical Society, 94, p. 4780, 1972 DOI: 10.1021/ja00768a084
Organic Syntheses, Coll. Vol. 6, p. 468, 1988
Tetrahedron Letters, 13, p. 2271, 1972 |
| | 4,4'-Dimethoxybiphenyl Preparation Products And Raw materials |
|