|
|
| | 2-(2,6-Dioxopiperidin-3-yl)-5-fluoroisoindoline-1,3-dione Basic information |
| Product Name: | 2-(2,6-Dioxopiperidin-3-yl)-5-fluoroisoindoline-1,3-dione | | Synonyms: | 1H-Isoindole-1,3(2H)-dione, 2-(2,6-dioxo-3-piperidinyl)-5-fluoro-;2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindoline-1,3-dione;135588;? 2-(2,6-Dioxopiperidin-3-yl)-5- difluoroisoindoline-1,3-dione;Light purple to off white powder;2-(2,6-dioxopiperidin-3-yl)-5-fluoro-2,3-dihydro-1H-isoindole-1,3-dione;2-(2,6-Dioxo-3-piperidinyl)-5-fluoro-1,3-isoindolinedione;1H-Isoindole-1,3(2H)-dione, 2-(2,6-dioxo-3-piperidinyl)-5-fl... | | CAS: | 835616-61-0 | | MF: | C13H9FN2O4 | | MW: | 276.22 | | EINECS: | | | Product Categories: | pharmaceutical | | Mol File: | 835616-61-0.mol |  |
| | 2-(2,6-Dioxopiperidin-3-yl)-5-fluoroisoindoline-1,3-dione Chemical Properties |
| Boiling point | 521.5±45.0 °C(Predicted) | | density | 1.570±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO: 83.33 mg/mL (301.68 mM) | | pka | 10.65±0.40(Predicted) | | form | Solid | | color | Off-white to gray | | InChI | InChI=1S/C13H9FN2O4/c14-6-1-2-7-8(5-6)13(20)16(12(7)19)9-3-4-10(17)15-11(9)18/h1-2,5,9H,3-4H2,(H,15,17,18) | | InChIKey | MPQLCQKBYRSPNA-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=C(F)C=C2)C(=O)N1C1CCC(=O)NC1=O |
| | 2-(2,6-Dioxopiperidin-3-yl)-5-fluoroisoindoline-1,3-dione Usage And Synthesis |
| Description | 2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindoline-1,3-dione is a thalidomide analog that can be useful in PROTAC research. | | Uses |
Thalidomide 5'- fluoro (2-(2,6-Dioxopiperidin-3-yl)-5-fluoroisoindoline-1,3-dione) is a derivative of Thalidomide, commonly used as a precursor to PROTAC® Degraders that hijacks cereblon as the E3 ubiquitin ligase component. Supplied with a fluoro functional handle at a position known not to significantly affect binding to cereblon, ready for conjugation to a linker/target protein ligand.
| | IC 50 | Cereblon | | storage | Store at +4°C |
| | 2-(2,6-Dioxopiperidin-3-yl)-5-fluoroisoindoline-1,3-dione Preparation Products And Raw materials |
|