| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
|
| | 1,3-Diazaspiro[4.5]decane-2,4-dione, 3-(phenylmethyl)- Basic information |
| | 1,3-Diazaspiro[4.5]decane-2,4-dione, 3-(phenylmethyl)- Chemical Properties |
| form | solid | | InChI | 1S/C15H18N2O2/c18-13-15(9-5-2-6-10-15)16-14(19)17(13)11-12-7-3-1-4-8-12/h1,3-4,7-8H,2,5-6,9-11H2,(H,16,19) | | InChIKey | KJEAJVJVRGZIDA-UHFFFAOYSA-N | | SMILES | O=C(NC12CCCCC2)N(CC3=CC=CC=C3)C1=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 1,3-Diazaspiro[4.5]decane-2,4-dione, 3-(phenylmethyl)- Usage And Synthesis |
| | 1,3-Diazaspiro[4.5]decane-2,4-dione, 3-(phenylmethyl)- Preparation Products And Raw materials |
|