(R)-(+)-4-ISOPROPYL-5,5-DIPHENYL-2-OXAZOLIDINONE manufacturers
|
| | (R)-(+)-4-ISOPROPYL-5,5-DIPHENYL-2-OXAZOLIDINONE Basic information |
| Product Name: | (R)-(+)-4-ISOPROPYL-5,5-DIPHENYL-2-OXAZOLIDINONE | | Synonyms: | (R)-(+)-4-ISOPROPYL-5,5-DIPHENYL-2-OXAZOLIDINONE;(R)-4-Isopropyl-5,5-diphenyl-2-oxazolidinone,99%e.e.;(4R)-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one;(4R)-(+)-4-Isopropyl-5,5-diphenyl-2-oxazolidinone>;2-Oxazolidinone, 4-(1-methylethyl)-5,5-diphenyl-, (4R)- | | CAS: | 191090-32-1 | | MF: | C18H19NO2 | | MW: | 281.35 | | EINECS: | | | Product Categories: | Intermediates of Sertraline;Asymmetric Synthesis;Chiral Auxiliaries;Oxazolidinone Derivatives | | Mol File: | 191090-32-1.mol |  |
| | (R)-(+)-4-ISOPROPYL-5,5-DIPHENYL-2-OXAZOLIDINONE Chemical Properties |
| Melting point | 252-255 °C(lit.) | | Boiling point | 475.7±45.0 °C(Predicted) | | density | 1.120±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 11.74±0.60(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]24/D +225°, c = 1% in chloroform | | InChI | InChI=1S/C18H19NO2/c1-13(2)16-18(21-17(20)19-16,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-13,16H,1-2H3,(H,19,20)/t16-/m1/s1 | | InChIKey | PHTOJBANGYSTOH-MRXNPFEDSA-N | | SMILES | O1C(C2=CC=CC=C2)(C2=CC=CC=C2)[C@@H](C(C)C)NC1=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2934999090 |
| | (R)-(+)-4-ISOPROPYL-5,5-DIPHENYL-2-OXAZOLIDINONE Usage And Synthesis |
| | (R)-(+)-4-ISOPROPYL-5,5-DIPHENYL-2-OXAZOLIDINONE Preparation Products And Raw materials |
| Raw materials | L-Arabinonic acid, 2,4-dideoxy-3-O-[(1,1-dimethylethyl)dimethylsilyl]-2,4-dimethyl-, δ-lactone-->(R)-tert-butyl 1-hydroxy-3-methyl-1,1-diphenylbutan-2-ylcarbamate-->Benzyl alcohol | | Preparation Products | L-Arabinonic acid, 2,4-dideoxy-2,4-dimethyl-3-O-(triethylsilyl)-, δ-lactone |
|