- asp(otbu)-ome.hcl
-
- $0.00 / 1kg
-
2026-04-02
- CAS:2673-19-0
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | H-ASP(OTBU)-OME HCL Basic information |
| | H-ASP(OTBU)-OME HCL Chemical Properties |
| Melting point | 167 °C (decomp) | | storage temp. | Inert atmosphere,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Solid | | color | White to off-white | | BRN | 6005591 | | Major Application | peptide synthesis | | InChI | 1S/C9H17NO4.ClH/c1-9(2,3)14-7(11)5-6(10)8(12)13-4;/h6H,5,10H2,1-4H3;1H/t6-;/m0./s1 | | InChIKey | SFYKWYAIJZEDNG-RGMNGODLSA-N | | SMILES | Cl[H].COC(=O)[C@@H](N)CC(=O)OC(C)(C)C |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | H-ASP(OTBU)-OME HCL Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | H-ASP(OTBU)-OME HCL Preparation Products And Raw materials |
|