| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
Specs |
| Tel: |
+31 15 251 8111 |
| Email: |
info@specs.net |
| Company Name: |
Fluorochem Ltd |
| Tel: |
(01457) 868921 (4 lines) |
| Email: |
vernam@fluorochem.co.uk |
| Company Name: |
OTAVA chemicals |
| Tel: |
416 305 9979 (Canada) |
| Email: |
north.america@otavachemicals.com |
|
| | OTAVA-BB BB7020331276 Basic information |
| Product Name: | OTAVA-BB BB7020331276 | | Synonyms: | 2-(3,4-Dichlorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid;OTAVA-BB BB7020331276;5-Thiazolecarboxylic acid, 2-(3,4-dichlorophenyl)-4-methyl- | | CAS: | 343322-58-7 | | MF: | C11H7Cl2NO2S | | MW: | 288.15 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | OTAVA-BB BB7020331276 Chemical Properties |
| Melting point | 254°(dec.) | | Boiling point | 480.9±55.0 °C(Predicted) | | density | 1.515±0.06 g/cm3(Predicted) | | form | solid | | pka | 2.15±0.37(Predicted) | | InChI | 1S/C11H7Cl2NO2S/c1-5-9(11(15)16)17-10(14-5)6-2-3-7(12)8(13)4-6/h2-4H,1H3,(H,15,16) | | InChIKey | IVDNVGTYTWMJSV-UHFFFAOYSA-N | | SMILES | [s]1c(nc(c1C(=O)O)C)c2cc(c(cc2)Cl)Cl |
| Hazard Codes | Xn | | Risk Statements | 22 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | OTAVA-BB BB7020331276 Usage And Synthesis |
| | OTAVA-BB BB7020331276 Preparation Products And Raw materials |
|