|
|
| | 2-Amino-5-(2,4-dimethyl-phenylcarbamoyl)-4-methyl-thiophene-3-carboxylic acid ethyl ester Basic information |
| Product Name: | 2-Amino-5-(2,4-dimethyl-phenylcarbamoyl)-4-methyl-thiophene-3-carboxylic acid ethyl ester | | Synonyms: | OTAVA-BB BB7016390803;TIMTEC-BB SBB001361;ETHYL 2-AMINO-5-[[(2,4-DIMETHYLPHENYL)AMINO]CARBONYL]-4-METHYLTHIOPHENE-3-CARBOXYLATE;ART-CHEM-BB B000729;AKOS B000729;Ethyl 2-amino-5-{[(2,4-dimethylphenyl)amino]-carbonyl}-4-methylthiophene-3-carbox;2-amino-5-[[(2,4-dimethylphenyl)amino]-oxomethyl]-4-methyl-3-thiophenecarboxylic acid ethyl ester;BIM-0046761.P001 | | CAS: | 329082-05-5 | | MF: | C17H20N2O3S | | MW: | 332.42 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 2-Amino-5-(2,4-dimethyl-phenylcarbamoyl)-4-methyl-thiophene-3-carboxylic acid ethyl ester Chemical Properties |
| Boiling point | 445.9±45.0 °C(Predicted) | | density | 1.262±0.06 g/cm3(Predicted) | | form | solid | | pka | 12.05±0.70(Predicted) | | InChI | 1S/C17H20N2O3S/c1-5-22-17(21)13-11(4)14(23-15(13)18)16(20)19-12-7-6-9(2)8-10(12)3/h6-8H,5,18H2,1-4H3,(H,19,20) | | InChIKey | RGIGVZONEAHWJZ-UHFFFAOYSA-N | | SMILES | O=C(NC1=C(C)C=C(C)C=C1)C2=C(C)C(C(OCC)=O)=C(N)S2 |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 2-Amino-5-(2,4-dimethyl-phenylcarbamoyl)-4-methyl-thiophene-3-carboxylic acid ethyl ester Usage And Synthesis |
| | 2-Amino-5-(2,4-dimethyl-phenylcarbamoyl)-4-methyl-thiophene-3-carboxylic acid ethyl ester Preparation Products And Raw materials |
|