|
|
| | 4-Nitro-N-methylphthalimide Basic information |
| | 4-Nitro-N-methylphthalimide Chemical Properties |
| Melting point | 94-98 °C(lit.) | | Boiling point | 361.1±25.0 °C(Predicted) | | density | 1.533±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | -3.51±0.20(Predicted) | | color | White to Orange to Green | | InChI | InChI=1S/C9H6N2O4/c1-10-8(12)6-3-2-5(11(14)15)4-7(6)9(10)13/h2-4H,1H3 | | InChIKey | JBCHWGTZAAZJKG-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=C([N+]([O-])=O)C=C2)C(=O)N1C | | CAS DataBase Reference | 41663-84-7(CAS DataBase Reference) | | EPA Substance Registry System | 4-Nitro-N-methylphthalimide (41663-84-7) |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26-36 | | WGK Germany | - | | RTECS | NR3398541 | | TSCA | TSCA listed | | HS Code | 2925.19.4200 |
| | 4-Nitro-N-methylphthalimide Usage And Synthesis |
| Uses | 2-Methyl-5-nitro-1H-isoindole-1,3(2H)-dione is a nitroaromatic compound that is toxic to bacteria, cells, animals, humans and their environment. | | Hazard | Moderately toxic by ingestion and skin contact. A mild skin irritant. |
| | 4-Nitro-N-methylphthalimide Preparation Products And Raw materials |
|