AA-115 (APG-115) manufacturers
- Alrizomadlin
-
- $48.00
-
2026-08-20
- CAS:1818393-16-6
- Purity: 98.79%
- Supply Ability: 10g
- Alrizomadlin
-
- $48.00
-
2026-07-27
- CAS:1818393-16-6
- Purity: 98.79%
- Supply Ability: 10g
|
| | AA-115 (APG-115) Basic information |
| Product Name: | AA-115 (APG-115) | | Synonyms: | AA-115 (APG-115);AA-115;Bicyclo[2.2.2]octane-1-carboxylic acid, 4-[[[(3'R,4'S,5'R)-6''-chloro-4'-(3-chloro-2-fluorophenyl)-1'-ethyl-1'',2''-dihydro-2''-oxodispiro[cyclohexane-1,2'-pyrrolidine-3',3''-[3H]indol]-5'-yl]carbonyl]amino]-;4-((3'R,4'S,5'R)-6''-Chloro-4'-(3-chloro-2-fluorophenyl)-1'-ethyl-2''-oxodispiro[cyclohexane-1,2'-pyrrolidine-3',3''-indoline]-5'-carboxamido)bicyclo[2.2.2]octane-1-carboxylic acid;4-{[(3'R,4'S,5'R)-6''-chloro-4'-(3-chloro-2-fluorophenyl)-1'-ethyl-2''-oxo-1'',2''-dihydrodispiro[cyclohexane-1,2'-pyrrolidine-3',3''-indol]-5'-yl]amido}bicyclo[2.2.2]octane-1-carboxylic acid;APG-115 (Alrizomadlin);Alrizomadlin/APG-115/AA-115;Alrizomadlin, 10 mM in DMSO | | CAS: | 1818393-16-6 | | MF: | C34H38Cl2FN3O4 | | MW: | 642.59 | | EINECS: | | | Product Categories: | | | Mol File: | 1818393-16-6.mol |  |
| | AA-115 (APG-115) Chemical Properties |
| Boiling point | 805.8±65.0 °C(Predicted) | | density | 1.42±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | Soluble in DMSO | | form | Solid | | pka | 4.76±0.10(Predicted) | | color | White to off-white | | InChIKey | YJCZPJQGFSSFOL-MNZPCBJKSA-N | | SMILES | C12(C(O)=O)CCC(NC([C@@H]3N(CC)C4([C@]5(C6=C(NC5=O)C=C(Cl)C=C6)[C@H]3C3=CC=CC(Cl)=C3F)CCCCC4)=O)(CC1)CC2 |
| | AA-115 (APG-115) Usage And Synthesis |
| Uses | APG 115 is used in the treatment and prevention of osteoarthritis. | | in vivo | Alrizomadlin (Delivered orally; 100 mg/kg; once daily; 10 days) enhances radiation antitumor effect in gastric adenocarcinoma in vivo[3]. | Animal Model: | Four-week-old male BALB/c athymic nude mice with MKN45 cells[3] | | Dosage: | 100 mg/kg | | Administration: | Deliverer orally; once daily; 10 days
| | Result: | Decreased xenograft tumor growth. |
|
| | AA-115 (APG-115) Preparation Products And Raw materials |
|