|
|
| | (S)-4-(anthracen-9-yl)-3-(te
rt-butyl)-2,3-dihydrobenzo
[d][1,3]oxaphosphole Basic information |
| Product Name: | (S)-4-(anthracen-9-yl)-3-(te
rt-butyl)-2,3-dihydrobenzo
[d][1,3]oxaphosphole | | Synonyms: | (S)-4-(anthracen-9-yl)-3-(te
rt-butyl)-2,3-dihydrobenzo
[d][1,3]oxaphosphole;(S)-4-(ANTHRACEN-9-YL)-3-(T-BUTYL-2,3-DIHYDROBENZO[D][1,3]OXAPHOSPHOLE,99+%(>99%EE)[(S)-ANTPHOS];(S)-4-(9-Anthracenyl)-3-(tert-butyl)-2,3-dihydro-1,3-benzoxaphosphole;(S)-AntPhos;ZJ-0024;99% ee) [(S)-AntPhos];(S)-4-(Anthracen-9-yl)-3-(t-butyl-2,3-dihydrobenzo[d][1,3]oxaphosphole,99+% (>1,3-Benzoxaphosphole, 4-(9-anthracenyl)-3-(1,1-dimethylethyl)-2,3-dihydro-, (3S)- | | CAS: | 1807740-34-6 | | MF: | C25H23OP | | MW: | 370.42 | | EINECS: | | | Product Categories: | Chiral Phosphine | | Mol File: | 1807740-34-6.mol | ![(S)-4-(anthracen-9-yl)-3-(te
rt-butyl)-2,3-dihydrobenzo
[d][1,3]oxaphosphole Structure](CAS/20180528/GIF/1807740-34-6.gif) |
| | (S)-4-(anthracen-9-yl)-3-(te
rt-butyl)-2,3-dihydrobenzo
[d][1,3]oxaphosphole Chemical Properties |
| Boiling point | 525.7±50.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | crystal | | color | light yellow | | Sensitive | air sensitive, store cold | | InChI | InChI=1S/C25H23OP/c1-25(2,3)27-16-26-22-14-8-13-21(24(22)27)23-19-11-6-4-9-17(19)15-18-10-5-7-12-20(18)23/h4-15H,16H2,1-3H3/t27-/m1/s1 | | InChIKey | HKAWVLHXUZNLPP-HHHXNRCGSA-N | | SMILES | O1C2=CC=CC(C3C4=CC=CC=C4C=C4C=3C=CC=C4)=C2[P@](C(C)(C)C)C1 |
| WGK Germany | WGK 3 | | HS Code | 2931499090 | | Storage Class | 11 - Combustible Solids |
| | (S)-4-(anthracen-9-yl)-3-(te
rt-butyl)-2,3-dihydrobenzo
[d][1,3]oxaphosphole Usage And Synthesis |
| Uses | (S)-AntPhos is a P-chiral monophosphorus ligand used for the asymmetric Suzuki-Miyaura and Miyaura borylation reactions. This ligand is uniquely effective for sterically hindered cross-coupling reactions. | | Reactions | 1. Ligand/palladium catalyst for general Miyaura borylation reactions.
2. Ligand/palladium catalyst for general and sterically demanding Suzuki-Miyaura cross-coupling reactions.
3. Ligand/palladium catalyst for aryl-alkyl Suzuki-Miyaura cross-coupling reactions.
4. Ligand/nickel catalyst for intramolecular reductive cyclization’
5. Ligand/palladium catalyst for Dearomative cyclization’
 | | reaction suitability | reagent type: ligand |
| | (S)-4-(anthracen-9-yl)-3-(te
rt-butyl)-2,3-dihydrobenzo
[d][1,3]oxaphosphole Preparation Products And Raw materials |
|