Bis(cyclohexanone)oxaldihydrazone manufacturers
- Cuprizone
-
- $35.00 / 1g
-
2026-02-25
- CAS:370-81-0
- Min. Order:
- Purity: ≥98%
- Supply Ability: 10g
|
| | Bis(cyclohexanone)oxaldihydrazone Basic information |
| Product Name: | Bis(cyclohexanone)oxaldihydrazone | | Synonyms: | DICYCLOHEXANONE OXALYLDIHYDRAZONE;CUPFERAZONE;CUPRIZON;CUPRIZON 1;CUPRIZONE;CUPRIZONE I;CUPRIZON I;BIS(CYCLOHEXANONE) OXALDIHYDRAZONE | | CAS: | 370-81-0 | | MF: | C14H22N4O2 | | MW: | 278.35 | | EINECS: | 206-729-2 | | Product Categories: | | | Mol File: | 370-81-0.mol |  |
| | Bis(cyclohexanone)oxaldihydrazone Chemical Properties |
| Melting point | 210-214 °C(lit.) | | Boiling point | 421.17°C (rough estimate) | | bulk density | 150kg/m3 | | density | 1.0823 (rough estimate) | | refractive index | 1.6200 (estimate) | | storage temp. | 2-8°C | | solubility | acetic acid: 50mg/mL, colorless to very faintly brown | | pka | 10.78±0.20(Predicted) | | form | Powder | | color | White | | Water Solubility | Soluble in alcohol. Insoluble in water. | | BRN | 2388004 | | InChI | 1S/C14H22N4O2/c19-13(17-15-11-7-3-1-4-8-11)14(20)18-16-12-9-5-2-6-10-12/h1-10H2,(H,17,19)(H,18,20) | | InChIKey | DSRJIHMZAQEUJV-UHFFFAOYSA-N | | SMILES | O=C(N\N=C1\CCCCC1)C(=O)N\N=C2/CCCCC2 | | CAS DataBase Reference | 370-81-0(CAS DataBase Reference) | | EPA Substance Registry System | Ethanedioic acid, bis(cyclohexylidenehydrazide) (370-81-0) |
| Hazard Codes | Xn | | Risk Statements | 21/22 | | Safety Statements | 24/25-2 | | WGK Germany | 3 | | RTECS | RO2520000 | | TSCA | TSCA listed | | HS Code | 29280090 | | Storage Class | 11 - Combustible Solids |
| | Bis(cyclohexanone)oxaldihydrazone Usage And Synthesis |
| Chemical Properties | white powder | | Uses | Bis(cyclohexanone) oxaldihydrazone is used in the quantitative spectroscopic determination of copper. It is also essential for the experimental study of mitochondrial metabolism. It is used to study the human demyelinating diseases such as multiple sclerosis and components of neuroinflammation. Further, it acts as ligand and catalyzes Ullmann-type C-N bond forming reactions in the presence of copper salt. | | Definition | ChEBI: Cuprizon is an organooxygen compound and an organonitrogen compound. It is functionally related to an alpha-amino acid. | | Biological Activity | Bis(cyclohexanone)oxaldihydrazone (Cuprizone) is a copper chelator. It results in oligodendroglial cell death, thereby leading to demyelination, astrogliosis and microglia activation. Cuprizone is widely used to study mitochondrial dysfunction-associated primary demyelination and remyelination in the corpus callosum. | | Safety Profile | Experimental
reproductive effects. Mutation data
reported. When heated to decomposition it
emits toxic fumes of NOx. See also
OXALATES. |
| | Bis(cyclohexanone)oxaldihydrazone Preparation Products And Raw materials |
|