| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
| Company Name: |
TCI AMERICA |
| Tel: |
800-4238616 |
| Email: |
sales@tciamerica.com |
|
| | 1-bromo-3,5-diethynylbenzene Basic information |
| | 1-bromo-3,5-diethynylbenzene Chemical Properties |
| Melting point | 110.2 °C | | Boiling point | 270.7±35.0 °C(Predicted) | | density | 1.48±0.1 g/cm3(Predicted) | | form | powder to crystal | | color | White to Light yellow to Light orange | | InChI | InChI=1S/C10H5Br/c1-3-8-5-9(4-2)7-10(11)6-8/h1-2,5-7H | | InChIKey | FEAVPUWKVFVMIF-UHFFFAOYSA-N | | SMILES | C1(Br)=CC(C#C)=CC(C#C)=C1 |
| | 1-bromo-3,5-diethynylbenzene Usage And Synthesis |
| | 1-bromo-3,5-diethynylbenzene Preparation Products And Raw materials |
|