|
|
| | 4-[2-(4-carboxyphenyl)ethyl]benzoic acid Basic information |
| Product Name: | 4-[2-(4-carboxyphenyl)ethyl]benzoic acid | | Synonyms: | 4-[2-(4-carboxyphenyl)ethyl]benzoic acid;1,3,5-benzene tricarboxylic acid tris[N-(4-pyridyl)amide];Benzene-1,3,5-tricarboxylic acid tris-pyridin-4-ylamide;N1,N3,N5-tris(pyridin-4-yl)benzene-1,3,5-tricarboxamide;N,N',N''-tri (4-pyridinyl)-1,3,5-benzenetricarboxamide;1,3,5-Tris(4-pyridylcarbamoyl)benzene;DK7694;DK7713 | | CAS: | 725274-03-3 | | MF: | C24H18N6O3 | | MW: | 438.44 | | EINECS: | | | Product Categories: | | | Mol File: | 725274-03-3.mol | ![4-[2-(4-carboxyphenyl)ethyl]benzoic acid Structure](CAS/20200119/GIF/725274-03-3.gif) |
| | 4-[2-(4-carboxyphenyl)ethyl]benzoic acid Chemical Properties |
| Boiling point | 526.1±50.0 °C(Predicted) | | density | 1.434±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 11.42±0.70(Predicted) | | Appearance | Off-white to light brown Solid | | InChIKey | PFHCOOYBRXRFAM-UHFFFAOYSA-N | | SMILES | C1(C(NC2C=CN=CC=2)=O)=CC(C(NC2C=CN=CC=2)=O)=CC(C(NC2C=CN=CC=2)=O)=C1 |
| | 4-[2-(4-carboxyphenyl)ethyl]benzoic acid Usage And Synthesis |
| | 4-[2-(4-carboxyphenyl)ethyl]benzoic acid Preparation Products And Raw materials |
|