|
|
| | Rhodium (triphenylphosphine)carbonylacetylacetonate Basic information | | Reaction |
| Product Name: | Rhodium (triphenylphosphine)carbonylacetylacetonate | | Synonyms: | ACETYLACETONATOCARBONYLTRIPHENYLPHOSPHINERHODIUM (L);Carbonyl-2,4-pentanedionato(triphenylphosphine)rhodium(I), Rh 21%;Acetylacetonatocarbonyltriphenylphosphinerhodium(I) ROPAC Major commercial hydroformylation catalyst;(Z)-4-oxo-2-penten-2-olate;Carbonyl(acetylacetonato)(triphenylphosphine)rhodium(I), 99%;Acetylacetonatocarbonyltriphenylphosphinerhodium(I) ROPAC Major commercial hydrof;ROPAC;Acetylacetonatocarbo | | CAS: | 25470-96-6 | | MF: | C24H23O3PRh | | MW: | 493.32 | | EINECS: | 247-015-0 | | Product Categories: | chemical reaction,pharm,electronic,materials;Rh | | Mol File: | 25470-96-6.mol |  |
| | Rhodium (triphenylphosphine)carbonylacetylacetonate Chemical Properties |
| Melting point | 200-204°C | | density | 1.5[at 20℃] | | vapor pressure | 0Pa at 25℃ | | solubility | Soluble in acetone and chlorinated solvents | | form | solid | | color | yellow | | Water Solubility | 24μg/L at 20℃ | | Merck | 14,356 | | Exposure limits | ACGIH: TWA 0.01 mg/m3; TWA 1 mg/m3
NIOSH: IDLH 2 mg/m3; IDLH 100 mg/m3; TWA 0.001 mg/m3; TWA 0.1 mg/m3 | | InChI | InChI=1S/C18H15P.C5H7O2.CO.Rh/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4(6)3-5(2)7;1-2;/h1-15H;3H,1-2H3;;/q;-1;;/p+1 | | InChIKey | ZETXURAVPSJSPU-UHFFFAOYSA-O | | SMILES | P(C1C=CC=CC=1)(C1C=CC=CC=1)(C1C=CC=CC=1)[Rh+]1(O=C(C)[CH-]C(C)=O1)C#O | | EPA Substance Registry System | Rhodium, carbonyl(2,4-pentanedionato-.kappa.O,.kappa.O')(triphenylphosphine)-, (SP-4-2)- (25470-96-6) |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | TSCA | TSCA listed | | HS Code | 28439000 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | Rhodium (triphenylphosphine)carbonylacetylacetonate Usage And Synthesis |
| Reaction | Rhodium catalyzed addition of fluorinated acid chlorides to alkynes
| | Chemical Properties | Yellow Powder | | Uses | Hydroformylation | | Flammability and Explosibility | Not classified |
| | Rhodium (triphenylphosphine)carbonylacetylacetonate Preparation Products And Raw materials |
|