CIS-11,14,17-EICOSATRIENOIC ACID METHYL ESTER manufacturers
|
| | CIS-11,14,17-EICOSATRIENOIC ACID METHYL ESTER Basic information |
| Product Name: | CIS-11,14,17-EICOSATRIENOIC ACID METHYL ESTER | | Synonyms: | CIS-11,14,17-EICOSATRIENOIC ACID METHYL ESTER;Methyl (11E,14E,17E)-11,14,17-icosatrienoate;Methyl cis-11,14,17-eicosatrienoate;cis-11,14,17-Eicosatrienoic acid Methyl ester (C20:3n3);11,14,17-Icosatrienoic acid methyl ester;cis-11,14,17-Eicosatrienoic acid Methyl ester (C20:3n3) Solution;CIS-11,14,17-EICOSATRIENOIC ACID MET;Methyl cis-11,14,17-Eicosatrienoate(C20:3) | | CAS: | 55682-88-7 | | MF: | C21H36O2 | | MW: | 320.51 | | EINECS: | | | Product Categories: | Esters;Methyl Esters;Unsaturated fatty acids and derivatives | | Mol File: | 55682-88-7.mol |  |
| | CIS-11,14,17-EICOSATRIENOIC ACID METHYL ESTER Chemical Properties |
| Boiling point | 398.6±11.0 °C(Predicted) | | density | 0.891±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | form | liquid | | biological source | synthetic (organic) | | InChI | 1S/C21H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23-2/h4-5,7-8,10-11H,3,6,9,12-20H2,1-2H3/b5-4+,8-7+,11-10+ | | InChIKey | XQAVRBUXEPJVRC-JSIPCRQOSA-N | | SMILES | CC\C=C\C\C=C\C\C=C\CCCCCCCCCC(=O)OC |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | CIS-11,14,17-EICOSATRIENOIC ACID METHYL ESTER Usage And Synthesis |
| Uses | cis-11,14,17-Eicosatrienoic Acid Methyl Ester is a fatty acid methyl ester (FAME) obtained from microalgal biomass that can exhibit anti-bacterial and anti-candidal activity. | | Definition | ChEBI: Cis-11,14,17-eicosatrienoic acid methyl ester is a fatty acid methyl ester. |
| | CIS-11,14,17-EICOSATRIENOIC ACID METHYL ESTER Preparation Products And Raw materials |
|