| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Boc-4-oxo-L-proline tert-butyl ester Basic information |
| Product Name: | Boc-4-oxo-L-proline tert-butyl ester | | Synonyms: | N-T-BOC-4-OXO-L-PROLINE TERT-BUTYL ESTER;N-BOC-4-OXO-L-PROLINE TERT-BUTYL ESTER;1,2-di-tert-butyl (2S)-4-oxopyrrolidine-1,2-
dicarboxylate;(2S) tert-butyl N-(tert-butoxycabonyl)-4-oxoprolinate;Boc-4-OXO-Pro-OtBu;ditert-butyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate;K204;-Di-tert-butyl 4-oxopyrrolidine-1,2-dicarboxylate | | CAS: | 166410-05-5 | | MF: | C14H23NO5 | | MW: | 285.34 | | EINECS: | 807-593-2 | | Product Categories: | | | Mol File: | 166410-05-5.mol |  |
| | Boc-4-oxo-L-proline tert-butyl ester Chemical Properties |
| Melting point | 64-67°C | | Boiling point | 366.7±42.0 °C(Predicted) | | density | 1.138±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | form | solid | | pka | -3.86±0.40(Predicted) | | color | White to off-white | | Optical Rotation | 10.2°(C=1g/100ml CHCL3) | | InChI | InChI=1S/C14H23NO5/c1-13(2,3)19-11(17)10-7-9(16)8-15(10)12(18)20-14(4,5)6/h10H,7-8H2,1-6H3/t10-/m0/s1 | | InChIKey | MPNWQUWKRDADHK-JTQLQIEISA-N | | SMILES | N1(C(OC(C)(C)C)=O)CC(=O)C[C@H]1C(OC(C)(C)C)=O | | LogP | 2.62 |
| | Boc-4-oxo-L-proline tert-butyl ester Usage And Synthesis |
| Synthesis | For the synthesis of di-tert-butyl (S)-4-oxopyrrolidine-1,2-dicarboxylate (16c), (S)-1-(tert-butoxycarbonyl)-4-oxopyrrolidine-2-carboxylic acid (16b, 1.35 g, 5.9 mmol) was dissolved in anhydrous dichloromethane (27 mL) and the solution was cooled to 0 °C. Subsequently, tert-butanol (1.7 mL, 17.7 mmol) and 4-dimethylaminopyridine (DMAP, 72 mg, 0.59 mmol) were sequentially added to the solution. After stirring for 5 min, 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide hydrochloride (EDC-HCl, 1.19 g, 6.2 mmol) was added. The reaction mixture was gradually warmed to room temperature and continued to stir overnight. Upon completion of the reaction, the reaction was quenched with saturated sodium bicarbonate solution and extracted three times with dichloromethane. The organic layers were combined, washed with saturated brine, dried over anhydrous magnesium sulfate and filtered. The solvent was removed by concentration under reduced pressure and the resulting residue was purified by fast column chromatography (eluent: n-hexane/ethyl acetate, 8:1) to afford the target product 16c (0.96 g, 57% yield) as a light yellow oil. | | References | [1] Tetrahedron, 1995, vol. 51, # 14, p. 4195 - 4212 [2] Patent: WO2017/53990, 2017, A1. Location in patent: Paragraph 00150 |
| | Boc-4-oxo-L-proline tert-butyl ester Preparation Products And Raw materials |
|