|
|
| | (1S,2R)-(+)-TRANS-2-PHENYL-1-CYCLOHEXANOL Basic information |
| | (1S,2R)-(+)-TRANS-2-PHENYL-1-CYCLOHEXANOL Chemical Properties |
| Melting point | 64-66 °C(lit.) | | Boiling point | 276-281 °C(lit.) | | density | 0.9452 (rough estimate) | | refractive index | 60 ° (C=10, MeOH) | | storage temp. | 2-8°C | | solubility | almost transparency in Methanol | | pka | 15.05±0.40(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]20/D +58°, c = 7 in methanol | | BRN | 4669439 | | InChI | 1S/C12H16O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-3,6-7,11-13H,4-5,8-9H2/t11-,12+/m1/s1 | | InChIKey | AAIBYZBZXNWTPP-NEPJUHHUSA-N | | SMILES | O[C@H]1CCCC[C@@H]1c2ccccc2 | | CAS DataBase Reference | 34281-92-0(CAS DataBase Reference) |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | HS Code | 2906.29.6000 | | Storage Class | 11 - Combustible Solids |
| | (1S,2R)-(+)-TRANS-2-PHENYL-1-CYCLOHEXANOL Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | (1S,2R)-(+)-trans-2-Phenyl-1-cyclohexanol can be used as a substrate in the study of permeability of alcohol enantiomers through the imprinted membranes to determine the permeability coefficient. |
| | (1S,2R)-(+)-TRANS-2-PHENYL-1-CYCLOHEXANOL Preparation Products And Raw materials |
|