2-Perfluoropropoxy-2,3,3,3-tetrafluoropropanol manufacturers
|
| | 2-Perfluoropropoxy-2,3,3,3-tetrafluoropropanol Basic information |
| Product Name: | 2-Perfluoropropoxy-2,3,3,3-tetrafluoropropanol | | Synonyms: | HFPO Oligomer alcohols (MW > 1000);2-HEPTAFLUOROPROPXY-2,3,3,3-TETRAFLUOROPROPAN-1-OL;2-HEPTAFLUOROPROPOXY-2,3,3,3-TETRAFLUOROPROPAN-1-OL;2-PERFLUOROPROPOXY-2,3,3,3-TETRAFLUOROPROPANOL;2-(Heptafluoropropxy)-2,3,3,3-tetrafluoropropan-1-ol 97%;2-(Heptafluoropropxy)-2,3,3,3-tetrafluoropropan-1-ol97%;1H,1H-Undecafluoro(2-methyl-3-oxahexan-1-ol) 97%;2-(Heptafluoropropxy)-2,3,3,3-tetrafluoropropan-1-ol, 1H,1H-Perfluoro(2-methyl-3-oxahexan-1-ol) | | CAS: | 26537-88-2 | | MF: | C6H3F11O2 | | MW: | 316.07 | | EINECS: | | | Product Categories: | | | Mol File: | 26537-88-2.mol |  |
| | 2-Perfluoropropoxy-2,3,3,3-tetrafluoropropanol Chemical Properties |
| Boiling point | 115°C | | density | 1.5529 g/cm3 | | storage temp. | Room Temperature, under inert atmosphere | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Oil | | pka | 12.50±0.10(Predicted) | | color | Colourless | | InChI | InChI=1S/C6H3F11O2/c7-2(1-18,4(10,11)12)19-6(16,17)3(8,9)5(13,14)15/h18H,1H2 | | InChIKey | MSOLHCPBFWYOSH-UHFFFAOYSA-N | | SMILES | C(O)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F | | EPA Substance Registry System | 2-(Perfluoropropoxy)-1H,1H-perfluoropropanol (26537-88-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | Hazard Note | Irritant | | HS Code | 2905599890 |
| | 2-Perfluoropropoxy-2,3,3,3-tetrafluoropropanol Usage And Synthesis |
| | 2-Perfluoropropoxy-2,3,3,3-tetrafluoropropanol Preparation Products And Raw materials |
|