- 4-BROMO-4'-N-PENTYLBIPHENYL
-
- $100.00 / 1KG
-
2025-09-25
- CAS:63619-59-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 4-BROMO-4'-N-PENTYLBIPHENYL Basic information |
| | 4-BROMO-4'-N-PENTYLBIPHENYL Chemical Properties |
| Melting point | 98 °C | | Boiling point | 200-202 °C(Press: 0.5 Torr) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | almost transparency in Toluene | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C17H19Br/c1-2-3-4-5-14-6-8-15(9-7-14)16-10-12-17(18)13-11-16/h6-13H,2-5H2,1H3 | | InChIKey | VXJTWTJULLKDPY-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(CCCCC)C=C2)=CC=C(Br)C=C1 | | CAS DataBase Reference | 63619-59-0(CAS DataBase Reference) |
| | 4-BROMO-4'-N-PENTYLBIPHENYL Usage And Synthesis |
| Chemical Properties | white or light yellow crystalline |
| | 4-BROMO-4'-N-PENTYLBIPHENYL Preparation Products And Raw materials |
|