| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:TebutaM
CAS:35256-85-0
Purity:100 μg/ML in Methanol Package:1ML
|
| Company Name: |
Sichuan Kulinan Technology Co., Ltd
|
| Tel: |
400-1166-196 18981987031 |
| Email: |
cdhxsj@163.com |
| Products Intro: |
Product Name:TEBUTAM
CAS:35256-85-0
Purity:99% HPLC Package:10g;50g;100g;500g;1kg;5kg;25kg
|
- TEBUTAM
-
- $1.00 / 1KG
-
2024-08-17
- CAS:35256-85-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
|
| | TEBUTAM Basic information |
| Product Name: | TEBUTAM | | Synonyms: | n-benzyl-n-isopropylpivalamide;n-benzyl-2,2-dimethyl-n-isopropyl-propionamid;Butam(TM);N-benzyl-2,2-dimethyl-N-propan-2-ylpropanamide;n-benzyl-n-isopropyltrimethylacetamide;s-15544;N-benzyl-N-isopropyl-2,2-dimethylpropionamide;2,6-DICHLOROBENZAMIDE PESTANAL | | CAS: | 35256-85-0 | | MF: | C15H23NO | | MW: | 233.35 | | EINECS: | 252-470-3 | | Product Categories: | | | Mol File: | 35256-85-0.mol |  |
| | TEBUTAM Chemical Properties |
| Melting point | <25℃ | | Boiling point | 96 °C | | density | 0.961±0.06 g/cm3(Predicted) | | Fp | 80 °C | | storage temp. | Refrigerator | | solubility | Chloroform, Methanol | | pka | -0.50±0.70(Predicted) | | color | Yellow | | BRN | 2838127 | | Major Application | agriculture
environmental | | InChI | 1S/C15H23NO/c1-12(2)16(14(17)15(3,4)5)11-13-9-7-6-8-10-13/h6-10,12H,11H2,1-5H3 | | InChIKey | RJKCKKDSSSRYCB-UHFFFAOYSA-N | | SMILES | CC(C)N(Cc1ccccc1)C(=O)C(C)(C)C | | EPA Substance Registry System | Butam (35256-85-0) |
| RIDADR | NA 1993 / PGIII | | WGK Germany | 2 | | RTECS | UE3152000 | | HS Code | 29242990 | | Storage Class | 10 - Combustible liquids | | Toxicity | guinea pig,LD50,oral,2025mg/kg (2025mg/kg),"Agrochemicals Handbook," with updates, Hartley, D., and H. Kidd, eds., Nottingham, Royal Soc of Chemistry, 1983-86Vol. A444, Pg. 1985, |
| | TEBUTAM Usage And Synthesis |
| Uses | Tebutam is used as herbicide and pesticide. | | Definition | ChEBI: A monocarboxylic acid amide that is propanamide substituted by a benzyl and an isopropyl group at the nitrogen atom and two methyl groups at position 2. It is an agrochemical used as a herbicide. |
| | TEBUTAM Preparation Products And Raw materials |
|