- 3-Methylbenzyl chloride
-
- $0.00 / 25KG
-
2025-12-01
- CAS:620-19-9
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 10000KGS
- 3-Methylbenzyl chloride
-
- $100.00 / 1KG
-
2025-09-25
- CAS:620-19-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 3-Methylbenzyl chloride Basic information |
| | 3-Methylbenzyl chloride Chemical Properties |
| Melting point | -41.95°C (estimate) | | Boiling point | 195-196 °C(lit.) | | density | 1.064 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.535(lit.) | | Fp | 168 °F | | storage temp. | 2-8°C | | form | Liquid | | color | Clear colorless to slightly yellow | | Water Solubility | Insoluble | | Merck | 14,10091 | | BRN | 2040357 | | InChI | InChI=1S/C8H9Cl/c1-7-3-2-4-8(5-7)6-9/h2-5H,6H2,1H3 | | InChIKey | LZBOHNCMCCSTJX-UHFFFAOYSA-N | | SMILES | C1(CCl)=CC=CC(C)=C1 | | CAS DataBase Reference | 620-19-9(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 1-(chloromethyl)-3-methyl-(620-19-9) |
| Hazard Codes | C,Xi | | Risk Statements | 34-36/37-36/37/38 | | Safety Statements | 23-26-27-36/37/39-45-37/39 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 2 | | Hazard Note | Irritant/Corrosive | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29036990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B STOT SE 3 |
| | 3-Methylbenzyl chloride Usage And Synthesis |
| Chemical Properties | clear colorless to slightly yellow liquid | | Uses | Intermediate. | | Uses | 3-Methylbenzyl chloride is used as an organic light-emitting diode and as an intermediate in organic synthesis. | | Hazard | Toxic by ingestion and inhalation, strong
irritant to eyes and skin. |
| | 3-Methylbenzyl chloride Preparation Products And Raw materials |
|