| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- BENZALDEHYDE AZINE
-
- $1.00
-
2020-01-15
- CAS:588-68-1
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 100kg
|
| | Benzaldehyde azine Basic information |
| Product Name: | Benzaldehyde azine | | Synonyms: | 1-phenyl-N-[(E)-(phenylmethylene)amino]methanimine;1,4-Diphenyl-2,3-diaza-1,3-butadiene;2-(PhenylMethylene)hydrazone Benzaldehyde;NSC 3269;(1E,2E)-1,2-dibenzylidenehydrazine;benzoaldehyde azine;Benzaldazin;Benzaldehyde [(E)-phenylmethylidene]hydrazone | | CAS: | 588-68-1 | | MF: | C14H12N2 | | MW: | 208.26 | | EINECS: | 209-627-6 | | Product Categories: | Aromatics;Intermediates;Miscellaneous Reagents | | Mol File: | 588-68-1.mol |  |
| | Benzaldehyde azine Chemical Properties |
| Melting point | 92-93 °C(lit.) | | Boiling point | 318.3±15.0 °C(Predicted) | | density | 0.98±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Solid | | pka | 6.72±0.50(Predicted) | | color | Pale Yellow to Yellow | | BRN | 2208840 | | InChI | InChI=1S/C14H12N2/c1-3-7-13(8-4-1)11-15-16-12-14-9-5-2-6-10-14/h1-12H | | InChIKey | CWLGEPSKQDNHIO-UHFFFAOYSA-N | | SMILES | C(=NN=CC1=CC=CC=C1)C1=CC=CC=C1 | | CAS DataBase Reference | 588-68-1(CAS DataBase Reference) | | EPA Substance Registry System | Benzaldehyde, (phenylmethylene)hydrazone (588-68-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | CU7571500 | | TSCA | TSCA listed | | HazardClass | IRRITANT, IRRITANT-HARMFUL | | HS Code | 2928009090 | | Toxicity | LD50 intraperitoneal in mouse: > 600mg/kg |
| | Benzaldehyde azine Usage And Synthesis |
| Chemical Properties | BENZALDEHYDE AZINE is Pale Yellow Solid | | Uses | BENZALDEHYDE AZINE is used in the synthesis of a variety of antibacterial and antifungal activities of symmetric and asymmetric azines. | | Definition | ChEBI: Dibenzylidenehydrazine is a member of benzenes and an azine. |
| | Benzaldehyde azine Preparation Products And Raw materials |
|