|
|
| | L-GLUCONO-1,5-LACTONE Basic information |
| Product Name: | L-GLUCONO-1,5-LACTONE | | Synonyms: | DELTA-LACTONE-L-GLUCONIC ACID;L-GLUCONO-1,5-LACTONE;L-Glucono-1,5-lactone, min. 85%;L-Gluconicacid,d-lactone;Glucuronic Acid Impurity 4;Dapagliflozin Impurity 76;L-Gluconic acid, δ-lactone;(3S,4R,5R,6S)-3,4,5-Trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-one | | CAS: | 52153-09-0 | | MF: | C6H10O6 | | MW: | 178.14 | | EINECS: | | | Product Categories: | | | Mol File: | 52153-09-0.mol |  |
| | L-GLUCONO-1,5-LACTONE Chemical Properties |
| Melting point | 142-144 °C(lit.) | | Boiling point | 230.35°C (rough estimate) | | density | 1.3253 (rough estimate) | | refractive index | 1.5860 (estimate) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Water (Slightly, Sonicated) | | pka | 12.13±0.70(Predicted) | | form | Solid | | color | White to Off-White | | Major Application | pharmaceutical small molecule | | InChIKey | PHOQVHQSTUBQQK-KLVWXMOXSA-N | | SMILES | OC[C@@H]1OC(=O)[C@@H](O)[C@H](O)[C@H]1O |
| WGK Germany | WGK 3 | | HS Code | 2932209090 | | Storage Class | 11 - Combustible Solids |
| | L-GLUCONO-1,5-LACTONE Usage And Synthesis |
| Chemical Properties | white powder | | Uses | L-Glucono-1,5-lactone is the lactone derivative of L-gluconic acid. |
| | L-GLUCONO-1,5-LACTONE Preparation Products And Raw materials |
|