- 3-(Methylthio)-1-hexanol
-
- $35.00 / 1kg
-
2025-09-25
- CAS:51755-66-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 3-(Methylthio)-1-hexanol Basic information |
| | 3-(Methylthio)-1-hexanol Chemical Properties |
| Boiling point | 61-62 °C10 mm Hg(lit.) | | density | 0.966 g/mL at 25 °C(lit.) | | FEMA | 3438 | 3-(METHYLTHIO)-1-HEXANOL | | refractive index | n20/D 1.4759(lit.) | | Fp | 226 °F | | pka | 14.90±0.10(Predicted) | | Odor | at 0.10 % in propylene glycol. sulfurous metallic green leafy vegetable | | Odor Type | sulfurous | | biological source | synthetic | | JECFA Number | 463 | | InChI | InChI=1S/C7H16OS/c1-3-4-7(9-2)5-6-8/h7-8H,3-6H2,1-2H3 | | InChIKey | JSASXSHMJYRPCM-UHFFFAOYSA-N | | SMILES | C(O)CC(SC)CCC | | LogP | 1.81 | | CAS DataBase Reference | 51755-66-9(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Methylthio-1-hexanol(51755-66-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | RIDADR | UN 3334 | | WGK Germany | 3 | | HazardClass | 9 | | HS Code | 29309099 |
| | 3-(Methylthio)-1-hexanol Usage And Synthesis |
| Description | 3-(Methylthio)-l-hexanol has a green, vegetable odor. | | Chemical Properties | 3-Methylthio-1-hexanol has a sulfurous onion, garlic green, vegetable odor. | | Chemical Properties | CLEAR SLIGHTLY YELLOW LIQUID | | Occurrence | Reported found in passion fruit and jackfrui | | Uses | 3-(Methylthio)-1-hexanol may be used in chemical synthesis. | | Aroma threshold values | Aroma characteristics at 1.0%: sulfurous, metallic and pungent with a slight spicy, green leafy, wasabi-like
and vegetative note with an earthy nuance | | Taste threshold values | Taste characteristics at 0.25 to 10 ppm: metallic, sulfurous with a green vegetative and slight spicy nuance. | | Biochem/physiol Actions | Taste at 0.25-10 ppm |
| | 3-(Methylthio)-1-hexanol Preparation Products And Raw materials |
|