|
|
| | 2-Amino-3-chloro-5-nitrobenzonitrile Basic information |
| Product Name: | 2-Amino-3-chloro-5-nitrobenzonitrile | | Synonyms: | TIMTEC-BB SBB003569;2-amino-3-chloro-5-nitro-benzonitril;6-CHLORO-2-CYANO-4-NITROANILINE;2-AMINO-3-CHLORO-5-NITROBENZONTRILE;2-CYANO-4-NITRO-6-CHLORO ANILINE;2-CYANO-6-CHLORO-4-NITROANILINE;2-AMINO-3-CHLORO-5-NITROBENZONITRILE;Benzonitrile, 2-amino-3-chloro-5-nitro- | | CAS: | 20352-84-5 | | MF: | C7H4ClN3O2 | | MW: | 197.58 | | EINECS: | 243-760-0 | | Product Categories: | Aromatic Nitriles;Nitrile | | Mol File: | 20352-84-5.mol |  |
| | 2-Amino-3-chloro-5-nitrobenzonitrile Chemical Properties |
| Melting point | 183-187 °C(lit.) | | Boiling point | 353.4±42.0 °C(Predicted) | | density | 1.7963 (rough estimate) | | refractive index | 1.5557 (estimate) | | pka | -4.10±0.20(Predicted) | | form | solid | | InChI | 1S/C7H4ClN3O2/c8-6-2-5(11(12)13)1-4(3-9)7(6)10/h1-2H,10H2 | | InChIKey | XVYNBLCPQVDRCH-UHFFFAOYSA-N | | SMILES | Nc1c(Cl)cc(cc1C#N)[N+]([O-])=O | | CAS DataBase Reference | 20352-84-5(CAS DataBase Reference) | | EPA Substance Registry System | Benzonitrile, 2-amino-3-chloro-5-nitro- (20352-84-5) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21-36-43-36/37/38 | | Safety Statements | 26-36/37-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29269095 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Eye Irrit. 2
Skin Sens. 1 |
| | 2-Amino-3-chloro-5-nitrobenzonitrile Usage And Synthesis |
| Chemical Properties | dark yellow powder |
| | 2-Amino-3-chloro-5-nitrobenzonitrile Preparation Products And Raw materials |
|