|
|
| | 5-Chloro-2-methyl-4-nitroaniline Basic information |
| Product Name: | 5-Chloro-2-methyl-4-nitroaniline | | Synonyms: | 2-AMINO-4-CHLORO-5-NITROTOLUENE;TIMTEC-BB SBB003702;2-METHYL-4-NITRO-5-CHLOROANILINE;5-CHLORO-2-METHYL-4-NITROANILINE;5-CHLORO-4-NITRO-O-TOLUIDINE;3-CHLORO-6-METHYL-4-NITROANILINE;LABOTEST-BB LT00000244;6-chloro-4-nitro-o-toluidine | | CAS: | 13852-51-2 | | MF: | C7H7ClN2O2 | | MW: | 186.6 | | EINECS: | 237-589-0 | | Product Categories: | | | Mol File: | 13852-51-2.mol |  |
| | 5-Chloro-2-methyl-4-nitroaniline Chemical Properties |
| Melting point | 164-167 °C (lit.) | | Boiling point | 375.2±37.0 °C(Predicted) | | density | 1.415±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | solid | | pka | -0.13±0.14(Predicted) | | color | Light yellow to yellow | | InChI | InChI=1S/C7H7ClN2O2/c1-4-2-7(10(11)12)5(8)3-6(4)9/h2-3H,9H2,1H3 | | InChIKey | OKOSGBYZOWWAPH-UHFFFAOYSA-N | | SMILES | C1(N)=CC(Cl)=C([N+]([O-])=O)C=C1C | | CAS DataBase Reference | 13852-51-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 2921420090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-Chloro-2-methyl-4-nitroaniline Usage And Synthesis |
| Chemical Properties | Yellow crystals or powder | | Uses | 5-Chloro-4-nitro-o-toluidine was used in the synthesis of 2-substituted 3,7,8-trichlorodibenzo-p-dioxins. |
| | 5-Chloro-2-methyl-4-nitroaniline Preparation Products And Raw materials |
|