|
|
| | Methyl (2R,3R)-2-Methylpiperidine-3-carboxylate Basic information |
| Product Name: | Methyl (2R,3R)-2-Methylpiperidine-3-carboxylate | | Synonyms: | Methyl (2R,3R)-2-Methylpiperidine-3-carboxylate;_x000D_Methyl (2R,3R)-2-Methylpiperidine-3-carboxylate;_x005f\rMethyl (2R，3R)-2-Methylpiperidine-3-carboxylate;3-Piperidinecarboxylic acid, 2-methyl-, methyl ester, (2R,3R)-;(2R,3R)-2-Methyl-piperidine-3-carboxylic acid methyl ester | | CAS: | 1864003-05-3 | | MF: | C8H15NO2 | | MW: | 157.21 | | EINECS: | | | Product Categories: | | | Mol File: | 1864003-05-3.mol |  |
| | Methyl (2R,3R)-2-Methylpiperidine-3-carboxylate Chemical Properties |
| Boiling point | 205.9±33.0 °C(Predicted) | | density | 0.982±0.06 g/cm3(Predicted) | | pka | 9.47±0.10(Predicted) | | InChI | InChI=1S/C8H15NO2/c1-6-7(8(10)11-2)4-3-5-9-6/h6-7,9H,3-5H2,1-2H3/t6-,7-/m1/s1 | | InChIKey | ZORUKIWYFWDAKK-RNFRBKRXSA-N | | SMILES | N1CCC[C@@H](C(OC)=O)[C@H]1C |
| | Methyl (2R,3R)-2-Methylpiperidine-3-carboxylate Usage And Synthesis |
| | Methyl (2R,3R)-2-Methylpiperidine-3-carboxylate Preparation Products And Raw materials |
|