|
|
| | Methyl 6-bromohexanoate Basic information |
| Product Name: | Methyl 6-bromohexanoate | | Synonyms: | 6-bromo-2-methylhexanoate;6-BROMOHEXANOIC ACID METHYL ESTER;METHYL 6-BROMOHEXANOATE;Methyl 6-bromohexanoate 98%;Methyl 6-bromohexanoate, 96+%;6-Methyl broMide has been;Methyl 6-broMohexanoate, 96+% 5GR;Methyl 6-bromocaproate | | CAS: | 14273-90-6 | | MF: | C7H13BrO2 | | MW: | 209.08 | | EINECS: | | | Product Categories: | | | Mol File: | 14273-90-6.mol |  |
| | Methyl 6-bromohexanoate Chemical Properties |
| Boiling point | 150°C/50mmHg | | density | 1.316 | | refractive index | 1.46 | | storage temp. | Sealed in dry,Room Temperature | | form | Liquid | | color | Clear colorless to pale yellow | | InChI | InChI=1S/C7H13BrO2/c1-10-7(9)5-3-2-4-6-8/h2-6H2,1H3 | | InChIKey | KYLVAMSNNZMHSX-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CCCCCBr | | CAS DataBase Reference | 14273-90-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | Hazard Note | Irritant | | HS Code | 29159000 |
| | Methyl 6-bromohexanoate Usage And Synthesis |
| Chemical Properties | Clear colorless to pale yellow liquid | | Synthesis | 1. Synthesis of methyl 6-bromohexanoate: Dissolve 5.01 g (25.7 mmol) of 6-bromohexanoic acid in 250 mL of methanol and introduce hydrogen chloride gas by vigorous bubbling for 2-3 minutes. The reaction mixture was stirred at 15-25°C for 3 hours. Upon completion of the reaction, the solvent was removed by concentration to give 4.84 g of yellow oily product in 90% yield. The product was characterized by 1H NMR (DMSO-d6): δ 3.58 (3H, s), 3.51 (2H, t), 2.29 (2H, t), 1.78 (2H, pentet), 1.62-1.27 ppm (4H, m). | | References | [1] Patent: US2002/15705, 2002, A1
[2] Patent: US4436746, 1984, A
[3] Patent: US4539410, 1985, A
[4] Patent: EP2425861, 2012, A1
[5] Patent: US2012/65367, 2012, A1 |
| | Methyl 6-bromohexanoate Preparation Products And Raw materials |
|