|
|
| | 4-[[(4-Fluorophenyl)imino]methyl]-phenol Basic information |
| | 4-[[(4-Fluorophenyl)imino]methyl]-phenol Chemical Properties |
| Melting point | 179.0 to 183.0 °C | | Boiling point | 370.9±27.0 °C(Predicted) | | density | 1.13±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 8.56±0.15(Predicted) | | color | Off-White to Dark Yellow | | InChI | InChI=1S/C13H10FNO/c14-11-3-5-12(6-4-11)15-9-10-1-7-13(16)8-2-10/h1-9,16H | | InChIKey | VNNJGDYPPLXJFF-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(C=NC2=CC=C(F)C=C2)C=C1 | | CAS DataBase Reference | 3382-63-6(CAS DataBase Reference) |
| | 4-[[(4-Fluorophenyl)imino]methyl]-phenol Usage And Synthesis |
| Chemical Properties | 4-[[(4-Fluorophenyl)imino]methyl]-phenol is Pale Yellow Solid | | Uses | 4-{[(p-Fluorophenyl)imino]methyl}phenol is used in the preparation of benzylacetones which promote anti-fungal activity. | | Synthesis |
4-[[(4-Fluorophenyl)imino]methyl]-phenol can be synthesized by reacting between 4-fluoroaniline and 4-hydroxybenzaldehyde.
|
| | 4-[[(4-Fluorophenyl)imino]methyl]-phenol Preparation Products And Raw materials |
|