|
|
| | 6-Chloro-2,2-dimethyl-4-chromanone Basic information |
| Product Name: | 6-Chloro-2,2-dimethyl-4-chromanone | | Synonyms: | 6-chloro-2,3-dihydro-2,2-dimethylchromen-4-one;4H-1-Benzopyran-4-one, 6-chloro-2,3-dihydro-2,2-dimethyl-;6-Chloro-2,2-dimethylchroman-4-one;6-Chloro-2,2-dimethyl-4-chromanone | | CAS: | 80055-85-2 | | MF: | C11H11ClO2 | | MW: | 210.66 | | EINECS: | | | Product Categories: | | | Mol File: | 80055-85-2.mol |  |
| | 6-Chloro-2,2-dimethyl-4-chromanone Chemical Properties |
| Melting point | 89-90 °C(Solv: ligroine (8032-32-4)) | | Boiling point | 95-100 °C(Press: 0.2-0.3 Torr) | | density | 1.209±0.06 g/cm3(Predicted) | | form | liquid | | InChIKey | OAQBJKPCYZKZJH-UHFFFAOYSA-N | | SMILES | Clc1cc2c(cc1)OC(CC2=O)(C)C |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids |
| | 6-Chloro-2,2-dimethyl-4-chromanone Usage And Synthesis |
| | 6-Chloro-2,2-dimethyl-4-chromanone Preparation Products And Raw materials |
|