4-NITROPHENYL CAPRYLATE manufacturers
- 4-Nitrophenyl caprylate
-
- $0.00 / 1G
-
2026-03-05
- CAS:1956-10-1
- Min. Order: 1G
- Purity: 98%min
- Supply Ability: 30kg/month
- 4-Nitrophenyl octanoate
-
- $243.00 / 25kg
-
2026-03-05
- CAS:1956-10-1
- Min. Order: 1kg
- Purity: 98.0%min 4-Nitrophenyl octanoate
- Supply Ability: 10tons/month
|
| | 4-NITROPHENYL CAPRYLATE Basic information | | Uses |
| Product Name: | 4-NITROPHENYL CAPRYLATE | | Synonyms: | 4-NITROPHENYL OCTANOATE;4-NITROPHENYL CAPRYLATE;P-NITROPHENYL CAPRYLATE;4-Nitrophenyl caprylate, Caprylic acid 4-nitrophenyl ester, Octanoic acid 4-nitrophenyl ester;Caprylic acid 4-nitrophenyl ester~4-Nitrophenyl octanoate~Octanoic acid 4-nitrophenyl ester;caprylic acid 4-nitrophenyl ester;4-Nitrophenyl octanoate,4-Nitrophenyl caprylate, Caprylic acid 4-nitrophenyl ester, Octanoic acid 4-nitrophenyl ester;Octanoic acid 4-nitrophenyl ester | | CAS: | 1956-10-1 | | MF: | C14H19NO4 | | MW: | 265.3 | | EINECS: | 628-560-7 | | Product Categories: | | | Mol File: | 1956-10-1.mol |  |
| | 4-NITROPHENYL CAPRYLATE Chemical Properties |
| Boiling point | 164 °C(Press: 0.3 Torr) | | density | 1.095 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.511 | | storage temp. | 2-8°C | | form | liquid | | Appearance | Colorless to light yellow Liquid | | BRN | 8989916 | | InChI | 1S/C14H19NO4/c1-2-3-4-5-6-7-14(16)19-13-10-8-12(9-11-13)15(17)18/h8-11H,2-7H2,1H3 | | InChIKey | GGIDEJQGAZSTES-UHFFFAOYSA-N | | SMILES | CCCCCCCC(=O)Oc1ccc(cc1)[N+]([O-])=O | | EPA Substance Registry System | Octanoic acid, 4-nitrophenyl ester (1956-10-1) |
| Hazard Codes | Xi | | Risk Statements | 43 | | Safety Statements | 36/37 | | WGK Germany | 3 | | F | 8-10-21 | | HS Code | 29159000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Skin Sens. 1 |
| | 4-NITROPHENYL CAPRYLATE Usage And Synthesis |
| Uses | 4-Nitrophenyl octanoate is an organic reagent whose structure is formed by replacing the hydrogen atom at the para position of a 4-nitrophenyl ester with an octanoate ester. It is used as a solvent in model systems of FP chamber reaction systems to construct a strongly coupled (VSC) environment of reactant and solvent molecules. |
| | 4-NITROPHENYL CAPRYLATE Preparation Products And Raw materials |
|