- 2,4-PENTANEDIOL
-
- $2.20 / 50kg
-
2025-10-13
- CAS:625-69-4
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 50kg
- 2,4-PENTANEDIOL
-
- $1.00 / 1KG
-
2020-01-13
- CAS:625-69-4
- Min. Order: 1KG
- Purity: 98%-99.9%
- Supply Ability: 200kg
|
| | 2,4-PENTANEDIOL Basic information |
| Product Name: | 2,4-PENTANEDIOL | | Synonyms: | 2,4-Pentanediol, mixture of isomers, 99%;2,4-pentanediol, dl + meso isomers;NSC 13528;NSC 53505;2,4-Pentanediol 98%;2,4-Dihydroxypentan;2,4-Pentanediol,99%,mixture of isomers;2,4-Pentanediol, (±) + meso, 99% | | CAS: | 625-69-4 | | MF: | C5H12O2 | | MW: | 104.15 | | EINECS: | 210-907-5 | | Product Categories: | Organic Building Blocks;Oxygen Compounds;Polyols | | Mol File: | 625-69-4.mol |  |
| | 2,4-PENTANEDIOL Chemical Properties |
| Melting point | 52.5°C | | Boiling point | 201-202 °C (lit.) | | density | 0.95 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.435(lit.) | | Fp | 215 °F | | storage temp. | Store below +30°C. | | solubility | Fully miscible. | | pka | 14.74±0.20(Predicted) | | form | clear liquid | | color | Syrup | | Sensitive | Hygroscopic | | BRN | 969186 | | InChI | InChI=1S/C5H12O2/c1-4(6)3-5(2)7/h4-7H,3H2,1-2H3 | | InChIKey | GTCCGKPBSJZVRZ-UHFFFAOYSA-N | | SMILES | CC(O)CC(O)C | | LogP | -0.386 (est) | | CAS DataBase Reference | 625-69-4(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 2 | | RTECS | SA0490000 | | HS Code | 2905399590 | | Toxicity | LD50 orl-rat: 6860 mg/kg AMIHBC 10,61,54 |
| | 2,4-PENTANEDIOL Usage And Synthesis |
| Chemical Properties | clear colorless to light yellow liquid | | Uses | 2,4-Pentanediol was used in the synthesis of chelated multinuclear complexes. | | Safety Profile | Mildly toxic by ingestion and skin contact. Eye irritant. When heated to decomposition it emits acrid smoke and irritating fumes. |
| | 2,4-PENTANEDIOL Preparation Products And Raw materials |
|