| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 2-O-Methyl-alpha-D-N-acetylneuraminic acid Basic information |
| | 2-O-Methyl-alpha-D-N-acetylneuraminic acid Chemical Properties |
| Melting point | 73-75°C | | Boiling point | 732.6±60.0 °C(predicted) | | density | 1.51±0.1 g/cm3(Temp: 20 °C; Press: 760 Torr)(predicted) | | storage temp. | -20°C | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | pka | 2.08±0.70(predicted) | | color | White to Pale Yellow | | Stability: | Moisture, Temperature Sensitive | | InChI | 1S/C12H21NO9/c1-5(15)13-8-6(16)3-12(21-2,11(19)20)22-10(8)9(18)7(17)4-14/h6-10,14,16-18H,3-4H2,1-2H3,(H,13,15)(H,19,20) | | InChIKey | NJRVVFURCKKXOD-UHFFFAOYSA-N | | SMILES | COC1(CC(O)C(NC(C)=O)C(O1)C(O)C(O)CO)C(O)=O |
| Hazard Codes | Xi | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29329990 | | Storage Class | 13 - Non Combustible Solids |
| | 2-O-Methyl-alpha-D-N-acetylneuraminic acid Usage And Synthesis |
| Chemical Properties | Off-White Powder | | Uses | A model compound for studies of binding of influenza virus hemaglutinin and metal ions. | | Uses | A model compound for studies of binding of influenza virus hemagglutinin and metal ions. | | Uses | 2-O-Methyl-α-D-N-acetylneuraminic Acid is a model compound for studies of binding of influenza virus hemagglutinin and metal ions. | | General Description | N-acetylneuraminic acid is the minimum binding epitope of rotavirus to host cells. |
| | 2-O-Methyl-alpha-D-N-acetylneuraminic acid Preparation Products And Raw materials |
|