- 3-Bromostyrene
-
- $1.00
-
2019-07-06
- CAS:2039-86-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kg
|
| | 3-Bromostyrene Basic information |
| | 3-Bromostyrene Chemical Properties |
| Boiling point | 74-75 °C/3 mmHg (lit.) | | density | 1.406 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.591(lit.) | | Fp | 154 °F | | storage temp. | 2-8°C | | form | Liquid | | Specific Gravity | 1.406 | | color | Clear colorless to yellow | | BRN | 2038490 | | InChI | InChI=1S/C8H7Br/c1-2-7-4-3-5-8(9)6-7/h2-6H,1H2 | | InChIKey | KQJQPCJDKBKSLV-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=CC(C=C)=C1 | | CAS DataBase Reference | 2039-86-3(CAS DataBase Reference) | | NIST Chemistry Reference | 3-BrC6H4CH=CH2(2039-86-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | 1993 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29039990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-Bromostyrene Usage And Synthesis |
| Chemical Properties | clear colorless to yellow liquid | | Uses | 1-Bromo-3-vinylbenzene acts as a reagent in the synthesis of methylaminopropiophenones used as a muscle relaxant in rats. |
| | 3-Bromostyrene Preparation Products And Raw materials |
|