|
| 3-(4-Chlorophenyl)propanoic acid Basic information |
| 3-(4-Chlorophenyl)propanoic acid Chemical Properties |
Melting point | 127-131 °C (lit.) | Boiling point | 263.86°C (rough estimate) | density | 1.1989 (rough estimate) | refractive index | 1.5242 (estimate) | storage temp. | Sealed in dry,Room Temperature | pka | 4.61(at 25℃) | form | solid | color | White to off white | InChI | InChI=1S/C9H9ClO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-2,4-5H,3,6H2,(H,11,12) | InChIKey | BBSLOKZINKEUCR-UHFFFAOYSA-N | SMILES | C1(CCC(O)=O)=CC=C(Cl)C=C1 | CAS DataBase Reference | 2019-34-3(CAS DataBase Reference) | NIST Chemistry Reference | 3-(4-Chlorophenyl)propionic acid(2019-34-3) |
Hazard Codes | Xn,Xi | Risk Statements | 22-41 | Safety Statements | 26-36/37/39 | WGK Germany | 2 | HazardClass | IRRITANT | HS Code | 29163990 |
| 3-(4-Chlorophenyl)propanoic acid Usage And Synthesis |
Chemical Properties | White to off-white solid |
| 3-(4-Chlorophenyl)propanoic acid Preparation Products And Raw materials |
|