|
|
| | 5-Amino-7-azaindole Basic information |
| Product Name: | 5-Amino-7-azaindole | | Synonyms: | 5-AMINO-7-AZAINDOLE;1H-PYRROLO[2,3-B]PYRIDIN-5-YLAMINE;1H-PYRROLO[2,3-B]PYRIDINE-5-AMINE;1H-Pyrrolo[2,3-b]pyridine,5-amino-(6CI);5-Amino-1H-pyrrolo[2,3-b]pyridine;1H-Pyrrolo[2,3-b]pyridin-5-ylaMine;5-AMino-7-aza-1H-indole;5-Amino-7-azaindole,97% | | CAS: | 100960-07-4 | | MF: | C7H7N3 | | MW: | 133.15 | | EINECS: | | | Product Categories: | PYRIDINE;API intermediates;Azaindoles | | Mol File: | 100960-07-4.mol |  |
| | 5-Amino-7-azaindole Chemical Properties |
| Melting point | 128-129°C | | Boiling point | 361.7±35.0 °C(Predicted) | | density | 1.41±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 8.28±0.20(Predicted) | | form | Solid | | color | Yellow to yellow/brown | | Sensitive | Light Sensitive | | InChI | InChI=1S/C7H7N3/c8-6-3-5-1-2-9-7(5)10-4-6/h1-4H,8H2,(H,9,10) | | InChIKey | PLWBENCHEUFMTN-UHFFFAOYSA-N | | SMILES | C12NC=CC1=CC(N)=CN=2 | | CAS DataBase Reference | 100960-07-4 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-36 | | Safety Statements | 26-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| | 5-Amino-7-azaindole Usage And Synthesis |
| Chemical Properties | Brown crystalline powder | | Synthesis | 5-Amino-7-azaindole is synthesised using 5-Nitro-7-azaindole as a raw material by chemical reaction. The specific synthesis steps are as follows:
To a stirred solution of 5nitro7azaindoie (500 rng, 3.07 rnmol) in methanol (125 rnL) under nitrogen atmosphere was added 10percent Pd/C (326 mg, 0.306 rnmol). The reaction was placed under an atmosphere of hydrogen gas and stirred at 20 °C overnight. The suspension was filtered through a pad of Celite 545, the resulting filter cake was washed with MeOH, and the combined organicphases concentrated in vaeuo to afford 5-Amino-7-azaindole compound (408 mg, 100percent). MS (ES1): mass calcd. for C7HN3 133.1, rn/z found 133.9 [M+H]t. ‘H NMR (300 MHz, DMSO-d6) 11.04 (s, 1H), 7.70 (d, J= 2.4 Hz, iH, 7.27 —7.18 (m, 1ff), 7.08 (d, J= 2.3 Hz, IH), 6.22 —6.06 (m, 1H), 4.62 (s, 2H).
 | | References | [1] Patent: WO2016/176460, 2016, A1. Location in patent: Page/Page column 98; 99
[2] Patent: US2007/112020, 2007, A1. Location in patent: Page/Page column 36
[3] Patent: EP2070928, 2009, A1. Location in patent: Page/Page column 92
[4] Synthesis, 2005, # 15, p. 2503 - 2506
[5] Patent: WO2008/28617, 2008, A1. Location in patent: Page/Page column 41; 27 |
| | 5-Amino-7-azaindole Preparation Products And Raw materials |
|