|
|
| | (-)-MENTHOXYACETIC ACID Basic information |
| | (-)-MENTHOXYACETIC ACID Chemical Properties |
| Melting point | 52-55 °C(lit.) | | Boiling point | 163-164 °C10 mm Hg(lit.) | | density | 1.01 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.4672(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,2-8°C | | pka | 3.47±0.10(Predicted) | | form | liquid | | color | yellow | | Optical Rotation | [α]25/D 92.5°, c = 4 in methanol | | BRN | 2444474 | | InChI | 1S/C12H22O3/c1-8(2)10-5-4-9(3)6-11(10)15-7-12(13)14/h8-11H,4-7H2,1-3H3,(H,13,14)/t9-,10+,11-/m1/s1 | | InChIKey | CILPHQCEVYJUDN-OUAUKWLOSA-N | | SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OCC(O)=O | | CAS DataBase Reference | 40248-63-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29189900 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (-)-MENTHOXYACETIC ACID Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | (-)-Menthyloxyacetic acid can be used as a chiral resolving agent[1]. | | References | [1] Luo X, et al. Enantiomeric resolution, thermodynamic parameters, and modeling of clausenamidone and neoclausenamidone on polysaccharide-based chiral stationary phases. Chirality. 2019 Jun;31(6):423-433. doi: 10.1002/chir.23068. Epub 2019 Apr 24. DOI:10.1002/chir.23068 |
| | (-)-MENTHOXYACETIC ACID Preparation Products And Raw materials |
|