| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 3-Carboxyphenylboronic acid Basic information |
| | 3-Carboxyphenylboronic acid Chemical Properties |
| Melting point | 243-247 °C (lit.) | | Boiling point | 434.5±47.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | pka | 4.21±0.10(Predicted) | | form | Crystalline Powder | | color | Off-white | | Water Solubility | 2.5 g/100 mL | | BRN | 2967400 | | InChI | InChI=1S/C7H7BO4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4,11-12H,(H,9,10) | | InChIKey | DBVFWZMQJQMJCB-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC(B(O)O)=C1 | | CAS DataBase Reference | 25487-66-5(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 37/39-26-36 | | WGK Germany | 2 | | RTECS | CY8750000 | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Toxicity | mouse,LD50,intravenous,2560mg/kg (2560mg/kg),"Boron, Metallo-Boron Compounds and Boranes," Adams, R.M., ed., New York, John Wiley & Sons, Inc., 1964Vol. -, Pg. 693, 1964. |
| | 3-Carboxyphenylboronic acid Usage And Synthesis |
| Chemical Properties | 3-Carboxyphenylboronic acid is off-white crystalline powder | | Uses | 3-Carboxyphenylboronic acid is used in Suzuki coupling chemistry.1,2,3 | | Uses | suzuki reaction | | Uses | 3-Carboxyphenylboronic acid can be used as a substrate in the preparation of:
- Biaryl derivatives by reacting with bromoaniline through the Suzuki-Miyaura coupling reaction.
- Boronic acid-functionalized block copolymer.
- 1H-Imidazo[1,2-a]quinoxaline derivatives.
| | Synthesis | 1. Synthesis of 3-carboxyphenylboronic acid: 10 g (68 mmol) of 3-cyanophenylboronic acid was suspended in 40 mL of ethylene glycol with 15.26 g (272 mmol, 4 eq.) of potassium hydroxide powder, heated to 175 °C and maintained for 3 hours. After completion of the reaction, the reaction mixture was cooled and diluted with 60 mL of water. The pH was adjusted to 2-3 with 32% hydrochloric acid solution, colorless crystalline 3-carboxyphenylboronic acid was precipitated and the product was separated by filtration. The resulting crystals were washed with water and dried under mild vacuum at 35 °C. The final product was 10.04 g in mass. The final product was 10.04 g (60.5 mmol, 89% yield). | | References | [1] Patent: US2009/286995, 2009, A1. Location in patent: Page/Page column 4 |
| | 3-Carboxyphenylboronic acid Preparation Products And Raw materials |
|