|
|
| | 3-(3-METHYLPHENYL)PROPIONIC ACID Basic information |
| Product Name: | 3-(3-METHYLPHENYL)PROPIONIC ACID | | Synonyms: | 3-m-Tolylpropionic acid;HydrocinnaMic acid, M-Methyl-;3-(3-Methylphenyl)propionic acid, 96%, 96%;m-Methylhydrocinnamic acid;Cinacalcet-28;3-METHYLHYDROCINNAMIC ACID;3-(3-METHYLPHENYL)PROPANOIC ACID;3-(3-METHYLPHENYL)PROPIONIC ACID | | CAS: | 3751-48-2 | | MF: | C10H12O2 | | MW: | 164.2 | | EINECS: | | | Product Categories: | | | Mol File: | 3751-48-2.mol |  |
| | 3-(3-METHYLPHENYL)PROPIONIC ACID Chemical Properties |
| Melting point | 39-42 °C (lit.) | | Boiling point | 290℃ | | density | 1.097 | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Acetone, DMSO, Methanol | | form | Solid | | pka | pK1:4.677 (25°C) | | color | Off-White to Pale Yellow | | InChI | InChI=1S/C10H12O2/c1-8-3-2-4-9(7-8)5-6-10(11)12/h2-4,7H,5-6H2,1H3,(H,11,12) | | InChIKey | VWXVTHDQAOAENP-UHFFFAOYSA-N | | SMILES | C1(CCC(O)=O)=CC=CC(C)=C1 | | CAS DataBase Reference | 3751-48-2(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-41-36/37/38 | | Safety Statements | 26-36/37/39-37/39 | | WGK Germany | 2 | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1 |
| | 3-(3-METHYLPHENYL)PROPIONIC ACID Usage And Synthesis |
| Chemical Properties | White solid | | Uses | 3-m-Tolylpropanoic Acid is used in the synthesis of piperidine antagonists as CCR1-selective inhibitors. via parallel synthesis. Also used in the synthesis of small molecule antagonists of vasoactive intestinal. peptide receptor1 (VIPR1). |
| | 3-(3-METHYLPHENYL)PROPIONIC ACID Preparation Products And Raw materials |
|