| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
2-(4-(2-(4-(Carboxymethoxy)-2,3-dichlorobenzoyl)-2,5-diethyl-3,4-dihydro-2H-pyran-6-yl)-2,3-dichlorophenoxy)acetic Acid manufacturers
|
| | 2-(4-(2-(4-(Carboxymethoxy)-2,3-dichlorobenzoyl)-2,5-diethyl-3,4-dihydro-2H-pyran-6-yl)-2,3-dichlorophenoxy)acetic Acid Basic information |
| Product Name: | 2-(4-(2-(4-(Carboxymethoxy)-2,3-dichlorobenzoyl)-2,5-diethyl-3,4-dihydro-2H-pyran-6-yl)-2,3-dichlorophenoxy)acetic Acid | | Synonyms: | 2-(4-(2-(4-(Carboxymethoxy)-2,3-dichlorobenzoyl)-2,5-diethyl-3,4-dihydro-2H-pyran-6-yl)-2,3-dichlorophenoxy)acetic Acid;Etacrynic Acid EP Impurity C;Acetic acid, [4-[2-[4-(carboxymethoxy)-2,3-dichlorobenzoyl]-3,4-dihydro-2,5-diethyl-2H-pyran-6-yl]-2,3-dichlorophenoxy]- (9CI);Etacrynic Acid Impurity 3 (Etacrynic Acid EP Impurity C);Antiuric acid 4;Ethacrynic acid pyrane dimer;Ethacrynic | | CAS: | 25355-92-4 | | MF: | C26H24Cl4O8 | | MW: | 606.28 | | EINECS: | | | Product Categories: | | | Mol File: | 25355-92-4.mol |  |
| | 2-(4-(2-(4-(Carboxymethoxy)-2,3-dichlorobenzoyl)-2,5-diethyl-3,4-dihydro-2H-pyran-6-yl)-2,3-dichlorophenoxy)acetic Acid Chemical Properties |
| Melting point | >66°C (dec.) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Pale Yellow | | Stability: | Hygroscopic | | SMILES | O=C(O)COC1=CC=C(C(=O)C2(OC(C=3C=CC(OCC(=O)O)=C(Cl)C3Cl)=C(CC)CC2)CC)C(Cl)=C1Cl |
| | 2-(4-(2-(4-(Carboxymethoxy)-2,3-dichlorobenzoyl)-2,5-diethyl-3,4-dihydro-2H-pyran-6-yl)-2,3-dichlorophenoxy)acetic Acid Usage And Synthesis |
| Uses | 2-(4-(2-(4-(Carboxymethoxy)-2,3-dichlorobenzoyl)-2,5-diethyl-3,4-dihydro-2H-pyran-6-yl)-2,3-dichlorophenoxy)acetic Acid is an impurity of Ethacrynic Acid (E676000), a diuretic used to treat high blood pressure and swelling caused by congestive heart failure, liver failure and kidney failure. |
| | 2-(4-(2-(4-(Carboxymethoxy)-2,3-dichlorobenzoyl)-2,5-diethyl-3,4-dihydro-2H-pyran-6-yl)-2,3-dichlorophenoxy)acetic Acid Preparation Products And Raw materials |
|