|
|
| | p-Toluenesulfonyl semicarbazide Basic information |
| Product Name: | p-Toluenesulfonyl semicarbazide | | Synonyms: | P-TOLUENESULFONYL SEMICARBAZIDE;RA PTSS;1-(p-tolylsulfonyl)-semicarbazide;1-tosylsemicarbazide;P-TOLUENE SULFONYL SEMICARBIZIDE;P-TOLUENESULFOHYL SEMICARBAZIDE;Benzenesulfonic acid, 4-methyl-, 2-(aminocarbonyl)hydrazide;4-METHYLBENZENESULPHONICACID,2-(AMINOCARBONYL)HYDRAZIDE | | CAS: | 10396-10-8 | | MF: | C8H11N3O3S | | MW: | 229.26 | | EINECS: | 233-857-6 | | Product Categories: | | | Mol File: | 10396-10-8.mol |  |
| | p-Toluenesulfonyl semicarbazide Chemical Properties |
| Melting point | 236 °C | | density | 1.381 | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | pka | 8.92±0.43(Predicted) | | form | Powder | | color | White | | InChI | InChI=1S/C8H11N3O3S/c1-6-2-4-7(5-3-6)15(13,14)11-10-8(9)12/h2-5,11H,1H3,(H3,9,10,12) | | InChIKey | VRFNYSYURHAPFL-UHFFFAOYSA-N | | SMILES | C1(S(NNC(N)=O)(=O)=O)=CC=C(C)C=C1 | | CAS DataBase Reference | 10396-10-8(CAS DataBase Reference) | | EPA Substance Registry System | Benzenesulfonic acid, 4-methyl-, 2-(aminocarbonyl)hydrazide (10396-10-8) |
| | p-Toluenesulfonyl semicarbazide Usage And Synthesis |
| Chemical Properties | Fine, white powder. | | Uses | Blowing Agent RA is high temperature foaming agent, so it's especially suitable for high temperature processing plastic. As a foaming agent, it can be used to produce synthetic rubber,for example:Hard PVC, High density polyethylene, polypropylene, polycarbonate, nylon, ABS, natural rubber, SBR,etc. The processing of this product is safe,and without the risk of foam in advance. Adding some active agent, it's suitable for low temperature foaming agent, for example: after using urea of surface treatment,it can reduce decomposition temperature. | | Uses | p-toluenesulfonyl semicarbazide is high-temperature N2 blowing agent .It can particularly used in high-temperature processing plastic such as ABS resin ,nylon,hard PVC ,HIDE,polypropylene,polycarbonate etc. |
| | p-Toluenesulfonyl semicarbazide Preparation Products And Raw materials |
|