- Ethoxyamidin
-
- $16.00 / 1ASSAYS
-
2022-02-25
- CAS:18637-00-8
- Min. Order: 1ASSAYS
- Purity: 99%
- Supply Ability: 20tons
|
| | 2-Ethoxybenzamidine hydrochloride Basic information |
| | 2-Ethoxybenzamidine hydrochloride Chemical Properties |
| Melting point | 132 - 137oC | | density | 1.213 | | vapor pressure | 0.001-0.657Pa at 20-96.23℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C9H12N2O.ClH/c1-2-12-8-6-4-3-5-7(8)9(10)11;/h3-6H,2H2,1H3,(H3,10,11);1H | | InChIKey | NGMHLSBQVIXGNZ-UHFFFAOYSA-N | | SMILES | C(C1C=CC=CC=1OCC)(N)=N.Cl | | Surface tension | 62.9mN/m at 1g/L and 20℃ | | CAS DataBase Reference | 18637-00-8(CAS DataBase Reference) |
| | 2-Ethoxybenzamidine hydrochloride Usage And Synthesis |
| Uses | 2-Ethoxybenzamidine hydrochloride is an impurity of Vardenafil (diHCl salt: V098001), a phosphodiesterase type 5 inhibitor that is used to treat men of varying aetiology with erectile dysfunction. |
| | 2-Ethoxybenzamidine hydrochloride Preparation Products And Raw materials |
|