|
|
| | Mono-methyl isophthalate Basic information |
| | Mono-methyl isophthalate Chemical Properties |
| Melting point | 194-196 °C (lit.) | | Boiling point | 339.3±25.0 °C(Predicted) | | density | 1.288±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | pka | 3.83±0.10(Predicted) | | form | Crystalline Powder | | color | White to off-white | | BRN | 2048750 | | InChI | InChI=1S/C9H8O4/c1-13-9(12)7-4-2-3-6(5-7)8(10)11/h2-5H,1H3,(H,10,11) | | InChIKey | WMZNGTSLFSJHMZ-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)=CC=CC(C(O)=O)=C1 | | CAS DataBase Reference | 1877-71-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 13 - Non Combustible Solids |
| | Mono-methyl isophthalate Usage And Synthesis |
| Chemical Properties | White to off-white crystalline powder | | Uses | Exploited in the synthesis of polymer films.1 | | Synthesis | To a solution of dimethyl isophthalate B2 (60 g, 0.31 mol) in 500 mL MeOH was added a solution of NaOH (12.4 g, 0.31 mol) in 200 mL MeOH. The mixture was stirred at room temperature overnight. It was concentrated and the residue was dissolved in 500 mL of water and extracted with Et2O. The aqueous solution was acidified with concentrated HCl. The white precipitate formed in the HCl solution at pH = 2 was collected and dried under vacuum to give 46 g of the crude compound monomethyl isophthalate as a white solid. |
| | Mono-methyl isophthalate Preparation Products And Raw materials |
|