|
| Mono-methyl isophthalate Basic information |
| Mono-methyl isophthalate Chemical Properties |
Melting point | 194-196 °C (lit.) | Boiling point | 339.3±25.0 °C(Predicted) | density | 1.288±0.06 g/cm3(Predicted) | storage temp. | Sealed in dry,Room Temperature | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | pka | 3.83±0.10(Predicted) | form | Crystalline Powder | color | White to off-white | BRN | 2048750 | InChI | InChI=1S/C9H8O4/c1-13-9(12)7-4-2-3-6(5-7)8(10)11/h2-5H,1H3,(H,10,11) | InChIKey | WMZNGTSLFSJHMZ-UHFFFAOYSA-N | SMILES | C1(C(OC)=O)=CC=CC(C(O)=O)=C1 | CAS DataBase Reference | 1877-71-0(CAS DataBase Reference) |
Hazard Codes | Xi | Risk Statements | 36/37/38 | Safety Statements | 26-36 | WGK Germany | 3 | HazardClass | IRRITANT | HS Code | 29163990 |
| Mono-methyl isophthalate Usage And Synthesis |
Chemical Properties | White to off-white crystalline powder | Uses | Exploited in the synthesis of polymer films.1 |
| Mono-methyl isophthalate Preparation Products And Raw materials |
|