|
|
| | Zinc disodium EDTA Basic information | | Uses |
| Product Name: | Zinc disodium EDTA | | Synonyms: | Ethylenediaminetetraacetic acid hydrate disodium zinc salt;Zincate(2-), [[N,N'-1,2-ethanediylbis[N-[(carboxy-kO)Methyl]glycinato-kN,kO]](4-)]-,sodiuM (1:2), (OC-6-21)-;EDTA Zinc DisodiuM (EDTA ZnNa);Zinc, sodium edetate;Zinc disodium EDTA;zinc disodium ethylenediaminetetraacetate;ETHYLENEDIAMINETETRAACETIC ACID ZINC*DISODIUM, PLANT;ETHYLENEDIAMINETETRAACETIC ACID DISODIUM ZTNC AR | | CAS: | 14025-21-9 | | MF: | C10H12N2NaO8Zn- | | MW: | 376.58 | | EINECS: | 237-865-0 | | Product Categories: | chelating agent;Organometallics;EDTA | | Mol File: | 14025-21-9.mol |  |
| | Zinc disodium EDTA Chemical Properties |
| density | 1.72[at 20℃] | | RTECS | ZG9213000 | | storage temp. | 2-8°C, sealed storage, away from moisture | | form | Powder | | color | White | | Water Solubility | almost transparency | | InChI | InChI=1S/C10H16N2O8.Na.Zn/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;/q;+1;+2/p-4 | | InChIKey | UBLOJEHIINPTTG-UHFFFAOYSA-J | | SMILES | O=C1CN23CCN45CC(=O)[O-][Zn+2]24([O-]C(=O)C5)([O-]C(=O)C3)[O-]1.[Na+] | | LogP | -10.32 | | CAS DataBase Reference | 14025-21-9(CAS DataBase Reference) | | EPA Substance Registry System | Zincate(2-), [[N,N'-1,2-ethanediylbis[N-[(carboxy-.kappa.O)methyl]glycinato-.kappa.N,.kappa.O]](4-)]-, sodium (1:2), (OC-6-21)- (14025-21-9) |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | TSCA | TSCA listed | | HS Code | 2922.49.8000 |
| Provider | Language |
|
ALFA
| English |
| | Zinc disodium EDTA Usage And Synthesis |
| Uses | Ethylenediaminetetraacetic Acid Disodium Zinc Salt is a powerful chelating agent and acts as a micro-nutrient in agriculture and horticulture. It also forms stable complexes with metal ions. | | Uses | Ethylenediaminetetraacetic Acid Disodium Zinc Salt is a powerful chelating agent and acts as a micro-nutrient in agriculture and horticulture. It also forms stable complexes with metal ions. | | Flammability and Explosibility | Non flammable |
| | Zinc disodium EDTA Preparation Products And Raw materials |
|