|
|
| | AMMONIUM-15N SULFATE Basic information |
| | AMMONIUM-15N SULFATE Chemical Properties |
| Melting point | >280 °C (dec.)(lit.) | | density | 1.225 g/mL at 25 °C | | refractive index | n20/D 1.391 | | form | Solid | | color | White to off-white | | InChI | InChI=1S/2H3N.H2O4S/c;;1-5(2,3)4/h2*1H3;(H2,1,2,3,4)/i2*1+1; | | InChIKey | BFNBIHQBYMNNAN-ISOLYIDJSA-N | | SMILES | S(=O)(=O)(O)O.[15NH3].[15NH3] | | CAS Number Unlabeled | 7783-20-2 | | CAS Number Unlabeled | 7783-20-2 | | CAS Number Unlabeled | 7783-20-2 |
| | AMMONIUM-15N SULFATE Usage And Synthesis |
| Chemical Properties | Solid | | Uses | Ammonium-15N2 sulfate finds its application
- In the field of agriculture research.
- As a marker to identify the digestibility sites in animal cattle.
- In metabolic labeling and quantification of proteome dynamic studie.
| | General Description | Ammonium-15N2 sulfate enriched with 15N isotope |
| | AMMONIUM-15N SULFATE Preparation Products And Raw materials |
|