|
|
| | 1,3,5-TRIVINYL-1,3,5-TRIMETHYLCYCLOTRISILOXANE Basic information |
| Product Name: | 1,3,5-TRIVINYL-1,3,5-TRIMETHYLCYCLOTRISILOXANE | | Synonyms: | Cyclotrisiloxane,2,4,6-triethenyl-2,4,6-trimethyl-;Methylvinylsiloxane cyclic trimer;trimethyl-trivinyl-cyclotrisiloxane;2,4,6-Trivinyl-2,4,6-trimethylcyclotrisiloxane;1,3,5-TRIVINYL-1,3,5-TRIMETHYLCYCLOTRISILOXANE 98+%;2,4,6-Triethenyl-2,4,6-trimethylcyclohexanetrisiloxane;2,4,6-Trimethyl-2,4,6-trivinyl-1,3,5-trioxa-2,4,6-trisilacyclohexane;2,4,6-Trimethyl-2,4,6-trivinylcyclohexanetrisiloxane | | CAS: | 3901-77-7 | | MF: | C9H18O3Si3 | | MW: | 258.5 | | EINECS: | 223-458-5 | | Product Categories: | Siloxanes | | Mol File: | 3901-77-7.mol |  |
| | 1,3,5-TRIVINYL-1,3,5-TRIMETHYLCYCLOTRISILOXANE Chemical Properties |
| Melting point | <0 | | Boiling point | 80°C 20mm | | density | 0,967 g/cm3 | | refractive index | 1.448 | | Fp | >65 | | storage temp. | Storage temp. 2-8°C | | form | clear liquid | | Specific Gravity | 0.967 | | color | Colorless to Almost colorless | | Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems | | InChI | InChI=1S/C9H18O3Si3/c1-7-13(4)10-14(5,8-2)12-15(6,9-3)11-13/h7-9H,1-3H2,4-6H3 | | InChIKey | BVTLTBONLZSBJC-UHFFFAOYSA-N | | SMILES | C([Si]1(O[Si](C)(C=C)O[Si](C)(C=C)O1)C)=C | | EPA Substance Registry System | Cyclotrisiloxane, 2,4,6-triethenyl-2,4,6-trimethyl- (3901-77-7) |
| Provider | Language |
|
ALFA
| English |
| | 1,3,5-TRIVINYL-1,3,5-TRIMETHYLCYCLOTRISILOXANE Usage And Synthesis |
| Chemical Properties | Colorless or yellowish transparent liquid |
| | 1,3,5-TRIVINYL-1,3,5-TRIMETHYLCYCLOTRISILOXANE Preparation Products And Raw materials |
|