|
|
| | 4-CHLORO-2-FLUOROBENZALDEHYDE Basic information |
| | 4-CHLORO-2-FLUOROBENZALDEHYDE Chemical Properties |
| Melting point | 58-61 °C | | Boiling point | 118-120 C | | density | 1.3310 (estimate) | | storage temp. | Inert atmosphere,2-8°C | | form | Crystals or Powder | | color | White to yellow-beigeor | | Water Solubility | Insoluble | | Sensitive | Air Sensitive | | BRN | 3537705 | | InChI | InChI=1S/C7H4ClFO/c8-6-2-1-5(4-10)7(9)3-6/h1-4H | | InChIKey | UVGYSEIWAOOIJR-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(Cl)C=C1F | | CAS DataBase Reference | 61072-56-8(CAS DataBase Reference) |
| | 4-CHLORO-2-FLUOROBENZALDEHYDE Usage And Synthesis |
| Chemical Properties | light yellow solid or liquids | | Uses | 4-Chloro-2-fluorobenzaldehyde is used as pharmaceutical intermediates. |
| | 4-CHLORO-2-FLUOROBENZALDEHYDE Preparation Products And Raw materials |
|