- Carbazole-9-ethanol
-
- $8.80 / 1KG
-
2019-07-10
- CAS:1484-14-6
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 100kg
|
| | Carbazole-9-ethanol Basic information |
| | Carbazole-9-ethanol Chemical Properties |
| Melting point | 78-82 °C(lit.) | | Boiling point | 220 °C(Press: 5 Torr) | | density | 1.17±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | Solid | | pka | 14.09±0.10(Predicted) | | color | White to yellow | | InChI | InChI=1S/C14H13NO/c16-10-9-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,16H,9-10H2 | | InChIKey | IIKVAWLYHHZRGV-UHFFFAOYSA-N | | SMILES | N1(CCO)C2=C(C=CC=C2)C2=C1C=CC=C2 | | CAS DataBase Reference | 1484-14-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 |
| | Carbazole-9-ethanol Usage And Synthesis |
| Uses | 9H-Carbazole-9-ethanol may be used to synthesize 2-(9H-carbazol-9-yl)ethyl methacrylate. | | General Description | 9H-Carbazole-9-ethanol (ECOH) is a carbazole derivative. |
| | Carbazole-9-ethanol Preparation Products And Raw materials |
|