|
|
| | 4-Amino-3-fluoropyridine Basic information |
| | 4-Amino-3-fluoropyridine Chemical Properties |
| Melting point | 71-79 °C | | Boiling point | 217.1±20.0 °C(Predicted) | | density | 1.257±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 7.19±0.12(Predicted) | | color | White to Light yellow to Light orange | | InChI | InChI=1S/C5H5FN2/c6-4-3-8-2-1-5(4)7/h1-3H,(H2,7,8) | | InChIKey | UFIKBUVVVGSMGW-UHFFFAOYSA-N | | SMILES | C1=NC=CC(N)=C1F | | CAS DataBase Reference | 2247-88-3(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | WGK Germany | nwg | | Hazard Note | Irritant | | HazardClass | 6.1 | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 4-Amino-3-fluoropyridine Usage And Synthesis |
| Chemical Properties | Yellow to light yellow crystals | | Uses | 4-Amino-3-fluoropyridine is an important intermediate in the synthesis of many new drugs, and it is an intermediate in the synthesis of transforming growth factor-β inhibitors and thrombin inhibitors. |
| | 4-Amino-3-fluoropyridine Preparation Products And Raw materials |
|