|
|
| | L-N-tau-Methyl-d3-histidine Basic information |
| | L-N-tau-Methyl-d3-histidine Chemical Properties |
| Melting point | ~240 °C (dec.) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Aqueous Base (Slightly), Water (Slightly) | | form | Solid | | color | Light Brown to Brown | | Optical Rotation | [α]20/D -24°, c =2 in H2O | | Stability: | Hygroscopic | | InChI | 1S/C7H11N3O2/c1-10-3-5(9-4-10)2-6(8)7(11)12/h3-4,6H,2,8H2,1H3,(H,11,12)/t6-/m0/s1/i1D3 | | InChIKey | BRMWTNUJHUMWMS-FYFSCIFKSA-N | | SMILES | [H][C@](N)(Cc1cn(cn1)C([2H])([2H])[2H])C(O)=O | | CAS Number Unlabeled | 332-80-9 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | L-N-tau-Methyl-d3-histidine Usage And Synthesis |
| Uses | Tau-(Methyl-d3)-L-Histidine can be used in standard solutions to use for plasma amino acid analysis. |
| | L-N-tau-Methyl-d3-histidine Preparation Products And Raw materials |
|